C28H26N2O5S — CID 23775449
2-[4-(1,3-benzodioxol-5-ylmethoxy)-3-methoxy-5-prop-2-enylphenyl]-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-4-one (PubChem CID 23775449) has the molecular formula C28H26N2O5S and a molecular weight of 502.59 g/mol. Its IUPAC name is 2-[4-(1,3-benzodioxol-5-ylmethoxy)-3-methoxy-5-prop-2-enylphenyl]-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-4-one.
| Compound Name | 2-[4-(1,3-benzodioxol-5-ylmethoxy)-3-methoxy-5-prop-2-enylphenyl]-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 23775449 |
| Molecular Formula | C28H26N2O5S |
| Molecular Weight | 502.59 g/mol |
| Exact Mass | 502.16 |
| IUPAC Name | 2-[4-(1,3-benzodioxol-5-ylmethoxy)-3-methoxy-5-prop-2-enylphenyl]-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-4-one |
| SMILES | C=CCc1cc(-c2nc3sc4c(c3c(=O)[nH]2)CCCC4)cc(OC)c1OCc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C28H26N2O5S/c1-3-6-17-12-18(26-29-27(31)24-19-7-4-5-8-23(19)36-28(24)30-26)13-22(32-2)25(17)33-14-16-9-10-20-21(11-16)35-15-34-20/h3,9-13H,1,4-8,14-15H2,2H3,(H,29,30,31) |
| InChIKey | YWFGJMDOXBRCGM-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 82.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.59 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|