C26H29NO4 — CID 23775599
2-[(3,4-dimethoxyphenyl)-(2-methyl-1H-indol-3-yl)methyl]-5,5-dimethylcyclohexane-1,3-dione (PubChem CID 23775599) has the molecular formula C26H29NO4 and a molecular weight of 419.52 g/mol. Its IUPAC name is 2-[(3,4-dimethoxyphenyl)-(2-methyl-1H-indol-3-yl)methyl]-5,5-dimethylcyclohexane-1,3-dione.
| Compound Name | 2-[(3,4-dimethoxyphenyl)-(2-methyl-1H-indol-3-yl)methyl]-5,5-dimethylcyclohexane-1,3-dione |
|---|---|
| PubChem CID | 23775599 |
| Molecular Formula | C26H29NO4 |
| Molecular Weight | 419.52 g/mol |
| Exact Mass | 419.21 |
| IUPAC Name | 2-[(3,4-dimethoxyphenyl)-(2-methyl-1H-indol-3-yl)methyl]-5,5-dimethylcyclohexane-1,3-dione |
| SMILES | COc1ccc(C(c2c(C)[nH]c3ccccc23)C2C(=O)CC(C)(C)CC2=O)cc1OC |
| InChI | InChI=1S/C26H29NO4/c1-15-23(17-8-6-7-9-18(17)27-15)24(16-10-11-21(30-4)22(12-16)31-5)25-19(28)13-26(2,3)14-20(25)29/h6-12,24-25,27H,13-14H2,1-5H3 |
| InChIKey | SRJMLMRGTLUUEG-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 68.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.52 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|