C23H28BNO6S — CID 23775783
[5-[(Z)-4-[(4R,7aS)-6-hydroxy-1,1-dioxo-3-propyl-2,4,7,7a-tetrahydrothieno[2,3-d]oxaborinin-4-yl]-2-pyridin-2-ylbut-1-enyl]furan-2-yl]methanol (PubChem CID 23775783) has the molecular formula C23H28BNO6S and a molecular weight of 457.36 g/mol. Its IUPAC name is [5-[(Z)-4-[(4R,7aS)-6-hydroxy-1,1-dioxo-3-propyl-2,4,7,7a-tetrahydrothieno[2,3-d]oxaborinin-4-yl]-2-pyridin-2-ylbut-1-enyl]furan-2-yl]methanol.
| Compound Name | [5-[(Z)-4-[(4R,7aS)-6-hydroxy-1,1-dioxo-3-propyl-2,4,7,7a-tetrahydrothieno[2,3-d]oxaborinin-4-yl]-2-pyridin-2-ylbut-1-enyl]furan-2-yl]methanol |
|---|---|
| PubChem CID | 23775783 |
| Molecular Formula | C23H28BNO6S |
| Molecular Weight | 457.36 g/mol |
| Exact Mass | 457.17 |
| IUPAC Name | [5-[(Z)-4-[(4R,7aS)-6-hydroxy-1,1-dioxo-3-propyl-2,4,7,7a-tetrahydrothieno[2,3-d]oxaborinin-4-yl]-2-pyridin-2-ylbut-1-enyl]furan-2-yl]methanol |
| SMILES | CCCC1=C2[C@@H](CC/C(=C/c3ccc(CO)o3)c3ccccn3)OB(O)C[C@@H]2S(=O)(=O)C1 |
| InChI | InChI=1S/C23H28BNO6S/c1-2-5-17-15-32(28,29)22-13-24(27)31-21(23(17)22)10-7-16(20-6-3-4-11-25-20)12-18-8-9-19(14-26)30-18/h3-4,6,8-9,11-12,21-22,26-27H,2,5,7,10,13-15H2,1H3/b16-12-/t21-,22+/m1/s1 |
| InChIKey | ZFAWZSCKZDHUSL-UUOUJJQOSA-N |
| XLogP | 3.26 |
| TPSA | 109.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.36 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|