C22H30BFO5S — CID 23775792
4-[(E)-2-[2-[(4R,7aS)-6-hydroxy-1,1-dioxo-3-propan-2-yl-2,4,7,7a-tetrahydrothieno[2,3-d]oxaborinin-4-yl]ethyl]pent-1-enyl]-2-fluorophenol (PubChem CID 23775792) has the molecular formula C22H30BFO5S and a molecular weight of 436.35 g/mol. Its IUPAC name is 4-[(E)-2-[2-[(4R,7aS)-6-hydroxy-1,1-dioxo-3-propan-2-yl-2,4,7,7a-tetrahydrothieno[2,3-d]oxaborinin-4-yl]ethyl]pent-1-enyl]-2-fluorophenol.
| Compound Name | 4-[(E)-2-[2-[(4R,7aS)-6-hydroxy-1,1-dioxo-3-propan-2-yl-2,4,7,7a-tetrahydrothieno[2,3-d]oxaborinin-4-yl]ethyl]pent-1-enyl]-2-fluorophenol |
|---|---|
| PubChem CID | 23775792 |
| Molecular Formula | C22H30BFO5S |
| Molecular Weight | 436.35 g/mol |
| Exact Mass | 436.19 |
| IUPAC Name | 4-[(E)-2-[2-[(4R,7aS)-6-hydroxy-1,1-dioxo-3-propan-2-yl-2,4,7,7a-tetrahydrothieno[2,3-d]oxaborinin-4-yl]ethyl]pent-1-enyl]-2-fluorophenol |
| SMILES | CCC/C(=C\c1ccc(O)c(F)c1)CC[C@H]1OB(O)C[C@H]2C1=C(C(C)C)CS2(=O)=O |
| InChI | InChI=1S/C22H30BFO5S/c1-4-5-15(10-16-6-8-19(25)18(24)11-16)7-9-20-22-17(14(2)3)13-30(27,28)21(22)12-23(26)29-20/h6,8,10-11,14,20-21,25-26H,4-5,7,9,12-13H2,1-3H3/b15-10+/t20-,21+/m1/s1 |
| InChIKey | IVWRGFPLTHPEFR-HJWSIBNYSA-N |
| XLogP | 4.12 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.35 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|