C25H29ClO5S — CID 23775819
3-chloro-4-[(Z,5R)-5-hydroxy-5-[(2R)-2-(hydroxymethyl)-1,1-dioxo-4-propyl-2,5-dihydrothiophen-3-yl]-2-phenylpent-1-enyl]phenol (PubChem CID 23775819) has the molecular formula C25H29ClO5S and a molecular weight of 477.02 g/mol. Its IUPAC name is 3-chloro-4-[(Z,5R)-5-hydroxy-5-[(2R)-2-(hydroxymethyl)-1,1-dioxo-4-propyl-2,5-dihydrothiophen-3-yl]-2-phenylpent-1-enyl]phenol.
| Compound Name | 3-chloro-4-[(Z,5R)-5-hydroxy-5-[(2R)-2-(hydroxymethyl)-1,1-dioxo-4-propyl-2,5-dihydrothiophen-3-yl]-2-phenylpent-1-enyl]phenol |
|---|---|
| PubChem CID | 23775819 |
| Molecular Formula | C25H29ClO5S |
| Molecular Weight | 477.02 g/mol |
| Exact Mass | 476.14 |
| IUPAC Name | 3-chloro-4-[(Z,5R)-5-hydroxy-5-[(2R)-2-(hydroxymethyl)-1,1-dioxo-4-propyl-2,5-dihydrothiophen-3-yl]-2-phenylpent-1-enyl]phenol |
| SMILES | CCCC1=C([C@H](O)CC/C(=C/c2ccc(O)cc2Cl)c2ccccc2)[C@H](CO)S(=O)(=O)C1 |
| InChI | InChI=1S/C25H29ClO5S/c1-2-6-20-16-32(30,31)24(15-27)25(20)23(29)12-10-18(17-7-4-3-5-8-17)13-19-9-11-21(28)14-22(19)26/h3-5,7-9,11,13-14,23-24,27-29H,2,6,10,12,15-16H2,1H3/b18-13-/t23-,24+/m1/s1 |
| InChIKey | XIJBQIVTLPMDGV-UOTMXHAUSA-N |
| XLogP | 4.61 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.02 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|