C22H25NO7S — CID 23776970
(3aS,5R,5aS,7S,8aS,8bR)-5a-hydroxy-7-[5-(hydroxymethyl)furan-2-yl]-5-(methoxymethyl)-2-(thiophen-2-ylmethyl)-4,5,7,8,8a,8b-hexahydro-3aH-furo[3,2-e]isoindole-1,3-dione (PubChem CID 23776970) has the molecular formula C22H25NO7S and a molecular weight of 447.51 g/mol. Its IUPAC name is (3aS,5R,5aS,7S,8aS,8bR)-5a-hydroxy-7-[5-(hydroxymethyl)furan-2-yl]-5-(methoxymethyl)-2-(thiophen-2-ylmethyl)-4,5,7,8,8a,8b-hexahydro-3aH-furo[3,2-e]isoindole-1,3-dione.
| Compound Name | (3aS,5R,5aS,7S,8aS,8bR)-5a-hydroxy-7-[5-(hydroxymethyl)furan-2-yl]-5-(methoxymethyl)-2-(thiophen-2-ylmethyl)-4,5,7,8,8a,8b-hexahydro-3aH-furo[3,2-e]isoindole-1,3-dione |
|---|---|
| PubChem CID | 23776970 |
| Molecular Formula | C22H25NO7S |
| Molecular Weight | 447.51 g/mol |
| Exact Mass | 447.14 |
| IUPAC Name | (3aS,5R,5aS,7S,8aS,8bR)-5a-hydroxy-7-[5-(hydroxymethyl)furan-2-yl]-5-(methoxymethyl)-2-(thiophen-2-ylmethyl)-4,5,7,8,8a,8b-hexahydro-3aH-furo[3,2-e]isoindole-1,3-dione |
| SMILES | COC[C@H]1C[C@@H]2C(=O)N(Cc3cccs3)C(=O)[C@@H]2[C@@H]2C[C@@H](c3ccc(CO)o3)O[C@]12O |
| InChI | InChI=1S/C22H25NO7S/c1-28-11-12-7-15-19(21(26)23(20(15)25)9-14-3-2-6-31-14)16-8-18(30-22(12,16)27)17-5-4-13(10-24)29-17/h2-6,12,15-16,18-19,24,27H,7-11H2,1H3/t12-,15+,16+,18+,19+,22-/m1/s1 |
| InChIKey | YOZQCVHRVNQCSQ-SYZAHARTSA-N |
| XLogP | 2.07 |
| TPSA | 109.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.51 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|