C38H42O9 — CID 23777625
[(1S,4R,6E,9R,12R,13S,15R,16R)-4,9-dibenzyl-15-(hydroxymethyl)-13-methoxy-3,10-dioxo-2,11,14-trioxabicyclo[10.4.0]hexadec-6-en-16-yl] 3-phenylpropanoate (PubChem CID 23777625) has the molecular formula C38H42O9 and a molecular weight of 642.75 g/mol. Its IUPAC name is [(1S,4R,6E,9R,12R,13S,15R,16R)-4,9-dibenzyl-15-(hydroxymethyl)-13-methoxy-3,10-dioxo-2,11,14-trioxabicyclo[10.4.0]hexadec-6-en-16-yl] 3-phenylpropanoate.
| Compound Name | [(1S,4R,6E,9R,12R,13S,15R,16R)-4,9-dibenzyl-15-(hydroxymethyl)-13-methoxy-3,10-dioxo-2,11,14-trioxabicyclo[10.4.0]hexadec-6-en-16-yl] 3-phenylpropanoate |
|---|---|
| PubChem CID | 23777625 |
| Molecular Formula | C38H42O9 |
| Molecular Weight | 642.75 g/mol |
| Exact Mass | 642.28 |
| IUPAC Name | [(1S,4R,6E,9R,12R,13S,15R,16R)-4,9-dibenzyl-15-(hydroxymethyl)-13-methoxy-3,10-dioxo-2,11,14-trioxabicyclo[10.4.0]hexadec-6-en-16-yl] 3-phenylpropanoate |
| SMILES | CO[C@H]1O[C@H](CO)[C@@H](OC(=O)CCc2ccccc2)[C@@H]2OC(=O)[C@@H](Cc3ccccc3)C/C=C/C[C@H](Cc3ccccc3)C(=O)O[C@@H]12 |
| InChI | InChI=1S/C38H42O9/c1-43-38-35-34(33(31(25-39)44-38)45-32(40)22-21-26-13-5-2-6-14-26)46-36(41)29(23-27-15-7-3-8-16-27)19-11-12-20-30(37(42)47-35)24-28-17-9-4-10-18-28/h2-18,29-31,33-35,38-39H,19-25H2,1H3/b12-11+/t29-,30-,31-,33-,34+,35-,38+/m1/s1 |
| InChIKey | GBJYFRSEXPIWDT-IDDGONSMSA-N |
| XLogP | 4.79 |
| TPSA | 117.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.75 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|