About [(Z,1S)-1-[2-(2-hydroxyethoxy)phenyl]-5-methylidene-4-quinolin-3-ylnon-3-enyl] acetate
[(Z,1S)-1-[2-(2-hydroxyethoxy)phenyl]-5-methylidene-4-quinolin-3-ylnon-3-enyl] acetate (PubChem CID 23777683) has the molecular formula C29H33NO4
and a molecular weight of 459.59 g/mol. Its IUPAC name is [(Z,1S)-1-[2-(2-hydroxyethoxy)phenyl]-5-methylidene-4-quinolin-3-ylnon-3-enyl] acetate.
Molecular Properties
| Compound Name | [(Z,1S)-1-[2-(2-hydroxyethoxy)phenyl]-5-methylidene-4-quinolin-3-ylnon-3-enyl] acetate |
| PubChem CID | 23777683 |
| Molecular Formula | C29H33NO4 |
| Molecular Weight | 459.59 g/mol |
| Exact Mass | 459.24 |
| IUPAC Name | [(Z,1S)-1-[2-(2-hydroxyethoxy)phenyl]-5-methylidene-4-quinolin-3-ylnon-3-enyl] acetate |
| SMILES | C=C(CCCC)/C(=C/C[C@H](OC(C)=O)c1ccccc1OCCO)c1cnc2ccccc2c1 |
| InChI | InChI=1S/C29H33NO4/c1-4-5-10-21(2)25(24-19-23-11-6-8-13-27(23)30-20-24)15-16-29(34-22(3)32)26-12-7-9-14-28(26)33-18-17-31/h6-9,11-15,19-20,29,31H,2,4-5,10,16-18H2,1,3H3/b25-15-/t29-/m0/s1 |
| InChIKey | NSFUQYJFGNRYCD-PZKKRVAUSA-N |
| XLogP | 6.43 |
| TPSA | 68.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 459.59 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze [(Z,1S)-1-[2-(2-hydroxyethoxy)phenyl]-5-methylidene-4-quinolin-3-ylnon-3-enyl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(Z,1S)-1-[2-(2-hydroxyethoxy)phenyl]-5-methylidene-4-quinolin-3-ylnon-3-enyl] acetate?
The IUPAC name of [(Z,1S)-1-[2-(2-hydroxyethoxy)phenyl]-5-methylidene-4-quinolin-3-ylnon-3-enyl] acetate (CID 23777683) is [(Z,1S)-1-[2-(2-hydroxyethoxy)phenyl]-5-methylidene-4-quinolin-3-ylnon-3-enyl] acetate.
What is the SMILES notation for [(Z,1S)-1-[2-(2-hydroxyethoxy)phenyl]-5-methylidene-4-quinolin-3-ylnon-3-enyl] acetate?
The canonical SMILES for [(Z,1S)-1-[2-(2-hydroxyethoxy)phenyl]-5-methylidene-4-quinolin-3-ylnon-3-enyl] acetate is C=C(CCCC)/C(=C/C[C@H](OC(C)=O)c1ccccc1OCCO)c1cnc2ccccc2c1.
What is the InChIKey of [(Z,1S)-1-[2-(2-hydroxyethoxy)phenyl]-5-methylidene-4-quinolin-3-ylnon-3-enyl] acetate?
The InChIKey is NSFUQYJFGNRYCD-PZKKRVAUSA-N. The full InChI is InChI=1S/C29H33NO4/c1-4-5-10-21(2)25(24-19-23-11-6-8-13-27(23)30-20-24)15-16-29(34-22(3)32)26-12-7-9-14-28(26)33-18-17-31/h6-9,11-15,19-20,29,31H,2,4-5,10,16-18H2,1,3H3/b25-15-/t29-/m0/s1.
What are the key properties of [(Z,1S)-1-[2-(2-hydroxyethoxy)phenyl]-5-methylidene-4-quinolin-3-ylnon-3-enyl] acetate?
[(Z,1S)-1-[2-(2-hydroxyethoxy)phenyl]-5-methylidene-4-quinolin-3-ylnon-3-enyl] acetate has a molecular weight of 459.59 g/mol, XLogP of 6.43, 12 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(Z,1S)-1-[2-(2-hydroxyethoxy)phenyl]-5-methylidene-4-quinolin-3-ylnon-3-enyl] acetate is sourced from PubChem (CID 23777683), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).