C38H40N2O10 — CID 23777687
[(2S,3R,4S)-1-benzoyl-2-(2-ethoxy-2-oxoethyl)-6-(3-hydroxypropoxy)-4-(3-methylbutanoylamino)-3,4-dihydro-2H-quinolin-3-yl] 2-oxochromene-3-carboxylate (PubChem CID 23777687) has the molecular formula C38H40N2O10 and a molecular weight of 684.74 g/mol. Its IUPAC name is [(2S,3R,4S)-1-benzoyl-2-(2-ethoxy-2-oxoethyl)-6-(3-hydroxypropoxy)-4-(3-methylbutanoylamino)-3,4-dihydro-2H-quinolin-3-yl] 2-oxochromene-3-carboxylate.
| Compound Name | [(2S,3R,4S)-1-benzoyl-2-(2-ethoxy-2-oxoethyl)-6-(3-hydroxypropoxy)-4-(3-methylbutanoylamino)-3,4-dihydro-2H-quinolin-3-yl] 2-oxochromene-3-carboxylate |
|---|---|
| PubChem CID | 23777687 |
| Molecular Formula | C38H40N2O10 |
| Molecular Weight | 684.74 g/mol |
| Exact Mass | 684.27 |
| IUPAC Name | [(2S,3R,4S)-1-benzoyl-2-(2-ethoxy-2-oxoethyl)-6-(3-hydroxypropoxy)-4-(3-methylbutanoylamino)-3,4-dihydro-2H-quinolin-3-yl] 2-oxochromene-3-carboxylate |
| SMILES | CCOC(=O)C[C@H]1[C@H](OC(=O)c2cc3ccccc3oc2=O)[C@@H](NC(=O)CC(C)C)c2cc(OCCCO)ccc2N1C(=O)c1ccccc1 |
| InChI | InChI=1S/C38H40N2O10/c1-4-47-33(43)22-30-35(50-38(46)28-20-25-13-8-9-14-31(25)49-37(28)45)34(39-32(42)19-23(2)3)27-21-26(48-18-10-17-41)15-16-29(27)40(30)36(44)24-11-6-5-7-12-24/h5-9,11-16,20-21,23,30,34-35,41H,4,10,17-19,22H2,1-3H3,(H,39,42)/t30-,34-,35-/m0/s1 |
| InChIKey | VULREAXKPQTCEV-RCTKZWLUSA-N |
| XLogP | 4.97 |
| TPSA | 161.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 50 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.74 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|