C13H16FNO4 — CID 23778585
(E,5R)-5-(3-fluoro-4-hydroxyphenyl)-N,5-dihydroxy-4,4-dimethylpent-2-enamide (PubChem CID 23778585) has the molecular formula C13H16FNO4 and a molecular weight of 269.27 g/mol. Its IUPAC name is (E,5R)-5-(3-fluoro-4-hydroxyphenyl)-N,5-dihydroxy-4,4-dimethylpent-2-enamide.
| Compound Name | (E,5R)-5-(3-fluoro-4-hydroxyphenyl)-N,5-dihydroxy-4,4-dimethylpent-2-enamide |
|---|---|
| PubChem CID | 23778585 |
| Molecular Formula | C13H16FNO4 |
| Molecular Weight | 269.27 g/mol |
| Exact Mass | 269.11 |
| IUPAC Name | (E,5R)-5-(3-fluoro-4-hydroxyphenyl)-N,5-dihydroxy-4,4-dimethylpent-2-enamide |
| SMILES | CC(C)(/C=C/C(=O)NO)[C@@H](O)c1ccc(O)c(F)c1 |
| InChI | InChI=1S/C13H16FNO4/c1-13(2,6-5-11(17)15-19)12(18)8-3-4-10(16)9(14)7-8/h3-7,12,16,18-19H,1-2H3,(H,15,17)/b6-5+/t12-/m0/s1 |
| InChIKey | QAWLNAGRKAXDRM-FYJFLYSWSA-N |
| XLogP | 1.65 |
| TPSA | 89.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.27 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|