C34H48N2O6 — CID 23781388
pent-4-enyl (5R,6S,7S)-2-[(2,5-dimethylphenyl)-prop-2-enylcarbamoyl]-7-ethyl-3-[(2R)-1-hydroxy-4-methylpentan-2-yl]-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate (PubChem CID 23781388) has the molecular formula C34H48N2O6 and a molecular weight of 580.77 g/mol. Its IUPAC name is pent-4-enyl (5R,6S,7S)-2-[(2,5-dimethylphenyl)-prop-2-enylcarbamoyl]-7-ethyl-3-[(2R)-1-hydroxy-4-methylpentan-2-yl]-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate.
| Compound Name | pent-4-enyl (5R,6S,7S)-2-[(2,5-dimethylphenyl)-prop-2-enylcarbamoyl]-7-ethyl-3-[(2R)-1-hydroxy-4-methylpentan-2-yl]-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate |
|---|---|
| PubChem CID | 23781388 |
| Molecular Formula | C34H48N2O6 |
| Molecular Weight | 580.77 g/mol |
| Exact Mass | 580.35 |
| IUPAC Name | pent-4-enyl (5R,6S,7S)-2-[(2,5-dimethylphenyl)-prop-2-enylcarbamoyl]-7-ethyl-3-[(2R)-1-hydroxy-4-methylpentan-2-yl]-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate |
| SMILES | C=CCCCOC(=O)[C@H]1[C@H]2C(=O)N([C@@H](CO)CC(C)C)C(C(=O)N(CC=C)c3cc(C)ccc3C)C23CC[C@]1(CC)O3 |
| InChI | InChI=1S/C34H48N2O6/c1-8-11-12-18-41-32(40)28-27-30(38)36(25(21-37)19-22(4)5)29(34(27)16-15-33(28,10-3)42-34)31(39)35(17-9-2)26-20-23(6)13-14-24(26)7/h8-9,13-14,20,22,25,27-29,37H,1-2,10-12,15-19,21H2,3-7H3/t25-,27+,28-,29?,33+,34?/m1/s1 |
| InChIKey | IAIKRBRGSAKWNP-UAQAULJPSA-N |
| XLogP | 4.89 |
| TPSA | 96.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.77 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|