C35H42N2O6 — CID 23782053
prop-2-enyl (5R,6S,7S)-2-[(2,6-dimethylphenyl)-prop-2-enylcarbamoyl]-3-[(2R)-1-hydroxy-3-phenylpropan-2-yl]-7,8-dimethyl-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate (PubChem CID 23782053) has the molecular formula C35H42N2O6 and a molecular weight of 586.73 g/mol. Its IUPAC name is prop-2-enyl (5R,6S,7S)-2-[(2,6-dimethylphenyl)-prop-2-enylcarbamoyl]-3-[(2R)-1-hydroxy-3-phenylpropan-2-yl]-7,8-dimethyl-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate.
| Compound Name | prop-2-enyl (5R,6S,7S)-2-[(2,6-dimethylphenyl)-prop-2-enylcarbamoyl]-3-[(2R)-1-hydroxy-3-phenylpropan-2-yl]-7,8-dimethyl-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate |
|---|---|
| PubChem CID | 23782053 |
| Molecular Formula | C35H42N2O6 |
| Molecular Weight | 586.73 g/mol |
| Exact Mass | 586.30 |
| IUPAC Name | prop-2-enyl (5R,6S,7S)-2-[(2,6-dimethylphenyl)-prop-2-enylcarbamoyl]-3-[(2R)-1-hydroxy-3-phenylpropan-2-yl]-7,8-dimethyl-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate |
| SMILES | C=CCOC(=O)[C@H]1[C@H]2C(=O)N([C@@H](CO)Cc3ccccc3)C(C(=O)N(CC=C)c3c(C)cccc3C)C23CC(C)[C@]1(C)O3 |
| InChI | InChI=1S/C35H42N2O6/c1-7-17-36(29-22(3)13-12-14-23(29)4)32(40)30-35-20-24(5)34(6,43-35)28(33(41)42-18-8-2)27(35)31(39)37(30)26(21-38)19-25-15-10-9-11-16-25/h7-16,24,26-28,30,38H,1-2,17-21H2,3-6H3/t24?,26-,27+,28-,30?,34+,35?/m1/s1 |
| InChIKey | PMEJMXHHVOQMAJ-NOCWZQMLSA-N |
| XLogP | 4.17 |
| TPSA | 96.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.73 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|