About N-(2-chlorophenyl)-4,4-dimethyl-5H-1,3-thiazol-2-amine
N-(2-chlorophenyl)-4,4-dimethyl-5H-1,3-thiazol-2-amine (PubChem CID 2378239) has the molecular formula C11H13ClN2S
and a molecular weight of 240.76 g/mol. Its IUPAC name is N-(2-chlorophenyl)-4,4-dimethyl-5H-1,3-thiazol-2-amine.
Molecular Properties
| Compound Name | N-(2-chlorophenyl)-4,4-dimethyl-5H-1,3-thiazol-2-amine |
| PubChem CID | 2378239 |
| Molecular Formula | C11H13ClN2S |
| Molecular Weight | 240.76 g/mol |
| Exact Mass | 240.05 |
| IUPAC Name | N-(2-chlorophenyl)-4,4-dimethyl-5H-1,3-thiazol-2-amine |
| SMILES | CC1(C)CSC(Nc2ccccc2Cl)=N1 |
| InChI | InChI=1S/C11H13ClN2S/c1-11(2)7-15-10(14-11)13-9-6-4-3-5-8(9)12/h3-6H,7H2,1-2H3,(H,13,14) |
| InChIKey | LTTMYELKHGQRAP-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.76 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(2-chlorophenyl)-4,4-dimethyl-5H-1,3-thiazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-chlorophenyl)-4,4-dimethyl-5H-1,3-thiazol-2-amine?
The IUPAC name of N-(2-chlorophenyl)-4,4-dimethyl-5H-1,3-thiazol-2-amine (CID 2378239) is N-(2-chlorophenyl)-4,4-dimethyl-5H-1,3-thiazol-2-amine.
What is the SMILES notation for N-(2-chlorophenyl)-4,4-dimethyl-5H-1,3-thiazol-2-amine?
The canonical SMILES for N-(2-chlorophenyl)-4,4-dimethyl-5H-1,3-thiazol-2-amine is CC1(C)CSC(Nc2ccccc2Cl)=N1.
What is the InChIKey of N-(2-chlorophenyl)-4,4-dimethyl-5H-1,3-thiazol-2-amine?
The InChIKey is LTTMYELKHGQRAP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13ClN2S/c1-11(2)7-15-10(14-11)13-9-6-4-3-5-8(9)12/h3-6H,7H2,1-2H3,(H,13,14).
What are the key properties of N-(2-chlorophenyl)-4,4-dimethyl-5H-1,3-thiazol-2-amine?
N-(2-chlorophenyl)-4,4-dimethyl-5H-1,3-thiazol-2-amine has a molecular weight of 240.76 g/mol, XLogP of 3.63, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-chlorophenyl)-4,4-dimethyl-5H-1,3-thiazol-2-amine is sourced from PubChem (CID 2378239), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).