About 1-(furan-2-ylmethyl)-2,5-dimethylpyrrole
1-(furan-2-ylmethyl)-2,5-dimethylpyrrole (PubChem CID 2378281) has the molecular formula C11H13NO
and a molecular weight of 175.23 g/mol. Its IUPAC name is 1-(furan-2-ylmethyl)-2,5-dimethylpyrrole.
Molecular Properties
| Compound Name | 1-(furan-2-ylmethyl)-2,5-dimethylpyrrole |
| PubChem CID | 2378281 |
| Molecular Formula | C11H13NO |
| Molecular Weight | 175.23 g/mol |
| Exact Mass | 175.10 |
| IUPAC Name | 1-(furan-2-ylmethyl)-2,5-dimethylpyrrole |
| SMILES | Cc1ccc(C)n1Cc1ccco1 |
| InChI | InChI=1S/C11H13NO/c1-9-5-6-10(2)12(9)8-11-4-3-7-13-11/h3-7H,8H2,1-2H3 |
| InChIKey | GHUVRTIRHVRLRU-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 18.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.23 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(furan-2-ylmethyl)-2,5-dimethylpyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(furan-2-ylmethyl)-2,5-dimethylpyrrole?
The IUPAC name of 1-(furan-2-ylmethyl)-2,5-dimethylpyrrole (CID 2378281) is 1-(furan-2-ylmethyl)-2,5-dimethylpyrrole.
What is the SMILES notation for 1-(furan-2-ylmethyl)-2,5-dimethylpyrrole?
The canonical SMILES for 1-(furan-2-ylmethyl)-2,5-dimethylpyrrole is Cc1ccc(C)n1Cc1ccco1.
What is the InChIKey of 1-(furan-2-ylmethyl)-2,5-dimethylpyrrole?
The InChIKey is GHUVRTIRHVRLRU-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13NO/c1-9-5-6-10(2)12(9)8-11-4-3-7-13-11/h3-7H,8H2,1-2H3.
What are the key properties of 1-(furan-2-ylmethyl)-2,5-dimethylpyrrole?
1-(furan-2-ylmethyl)-2,5-dimethylpyrrole has a molecular weight of 175.23 g/mol, XLogP of 2.75, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(furan-2-ylmethyl)-2,5-dimethylpyrrole is sourced from PubChem (CID 2378281), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).