(4-chlorophenyl)methyl 2-(2-chlorophenoxy)acetate

C15H12Cl2O3 — CID 2378588

IUPAC(4-chlorophenyl)methyl 2-(2-chlorophenoxy)acetate
SMILESO=C(COc1ccccc1Cl)OCc1ccc(Cl)cc1
InChIInChI=1S/C15H12Cl2O3/c16-12-7-5-11(6-8-12)9-20-15(18)10-19-14-4-2-1-3-13(14)17/h1-8H,9-10H2
InChIKeyAYFKFGLJEGLDFE-UHFFFAOYSA-N
MW311.16 g/mol
LogP4.12
Rot. Bonds5

About (4-chlorophenyl)methyl 2-(2-chlorophenoxy)acetate

(4-chlorophenyl)methyl 2-(2-chlorophenoxy)acetate (PubChem CID 2378588) has the molecular formula C15H12Cl2O3 and a molecular weight of 311.16 g/mol. Its IUPAC name is (4-chlorophenyl)methyl 2-(2-chlorophenoxy)acetate.

Molecular Properties

Compound Name(4-chlorophenyl)methyl 2-(2-chlorophenoxy)acetate
PubChem CID2378588
Molecular FormulaC15H12Cl2O3
Molecular Weight311.16 g/mol
Exact Mass310.02
IUPAC Name(4-chlorophenyl)methyl 2-(2-chlorophenoxy)acetate
SMILESO=C(COc1ccccc1Cl)OCc1ccc(Cl)cc1
InChIInChI=1S/C15H12Cl2O3/c16-12-7-5-11(6-8-12)9-20-15(18)10-19-14-4-2-1-3-13(14)17/h1-8H,9-10H2
InChIKeyAYFKFGLJEGLDFE-UHFFFAOYSA-N
XLogP4.12
TPSA35.53 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds5
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500311.16
LogP ≤ 54.12
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Analyze (4-chlorophenyl)methyl 2-(2-chlorophenoxy)acetate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (4-chlorophenyl)methyl 2-(2-chlorophenoxy)acetate?
The IUPAC name of (4-chlorophenyl)methyl 2-(2-chlorophenoxy)acetate (CID 2378588) is (4-chlorophenyl)methyl 2-(2-chlorophenoxy)acetate.
What is the SMILES notation for (4-chlorophenyl)methyl 2-(2-chlorophenoxy)acetate?
The canonical SMILES for (4-chlorophenyl)methyl 2-(2-chlorophenoxy)acetate is O=C(COc1ccccc1Cl)OCc1ccc(Cl)cc1.
What is the InChIKey of (4-chlorophenyl)methyl 2-(2-chlorophenoxy)acetate?
The InChIKey is AYFKFGLJEGLDFE-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12Cl2O3/c16-12-7-5-11(6-8-12)9-20-15(18)10-19-14-4-2-1-3-13(14)17/h1-8H,9-10H2.
What are the key properties of (4-chlorophenyl)methyl 2-(2-chlorophenoxy)acetate?
(4-chlorophenyl)methyl 2-(2-chlorophenoxy)acetate has a molecular weight of 311.16 g/mol, XLogP of 4.12, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4-chlorophenyl)methyl 2-(2-chlorophenoxy)acetate is sourced from PubChem (CID 2378588), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).