C16H28O5 — CID 23786306
(5E)-2-heptyl-3,4,7-trihydroxy-2,3,4,7,8,9-hexahydrooxecin-10-one (PubChem CID 23786306) has the molecular formula C16H28O5 and a molecular weight of 300.39 g/mol. Its IUPAC name is (5E)-2-heptyl-3,4,7-trihydroxy-2,3,4,7,8,9-hexahydrooxecin-10-one.
| Compound Name | (5E)-2-heptyl-3,4,7-trihydroxy-2,3,4,7,8,9-hexahydrooxecin-10-one |
|---|---|
| PubChem CID | 23786306 |
| Molecular Formula | C16H28O5 |
| Molecular Weight | 300.39 g/mol |
| Exact Mass | 300.19 |
| IUPAC Name | (5E)-2-heptyl-3,4,7-trihydroxy-2,3,4,7,8,9-hexahydrooxecin-10-one |
| SMILES | CCCCCCCC1OC(=O)CCC(O)/C=C/C(O)C1O |
| InChI | InChI=1S/C16H28O5/c1-2-3-4-5-6-7-14-16(20)13(18)10-8-12(17)9-11-15(19)21-14/h8,10,12-14,16-18,20H,2-7,9,11H2,1H3/b10-8+ |
| InChIKey | NGMQJZCKXKTQID-CSKARUKUSA-N |
| XLogP | 1.69 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.39 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|