About (E)-1,7-bis(4-hydroxyphenyl)hept-4-en-3-one
(E)-1,7-bis(4-hydroxyphenyl)hept-4-en-3-one (PubChem CID 23786382) has the molecular formula C19H20O3
and a molecular weight of 296.37 g/mol. Its IUPAC name is (E)-1,7-bis(4-hydroxyphenyl)hept-4-en-3-one.
Molecular Properties
| Compound Name | (E)-1,7-bis(4-hydroxyphenyl)hept-4-en-3-one |
| PubChem CID | 23786382 |
| Molecular Formula | C19H20O3 |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.14 |
| IUPAC Name | (E)-1,7-bis(4-hydroxyphenyl)hept-4-en-3-one |
| SMILES | O=C(/C=C/CCc1ccc(O)cc1)CCc1ccc(O)cc1 |
| InChI | InChI=1S/C19H20O3/c20-17(10-7-16-8-13-19(22)14-9-16)4-2-1-3-15-5-11-18(21)12-6-15/h2,4-6,8-9,11-14,21-22H,1,3,7,10H2/b4-2+ |
| InChIKey | GIKJADRKBZHVCY-DUXPYHPUSA-N |
| XLogP | 3.79 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-1,7-bis(4-hydroxyphenyl)hept-4-en-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-1,7-bis(4-hydroxyphenyl)hept-4-en-3-one?
The IUPAC name of (E)-1,7-bis(4-hydroxyphenyl)hept-4-en-3-one (CID 23786382) is (E)-1,7-bis(4-hydroxyphenyl)hept-4-en-3-one.
What is the SMILES notation for (E)-1,7-bis(4-hydroxyphenyl)hept-4-en-3-one?
The canonical SMILES for (E)-1,7-bis(4-hydroxyphenyl)hept-4-en-3-one is O=C(/C=C/CCc1ccc(O)cc1)CCc1ccc(O)cc1.
What is the InChIKey of (E)-1,7-bis(4-hydroxyphenyl)hept-4-en-3-one?
The InChIKey is GIKJADRKBZHVCY-DUXPYHPUSA-N. The full InChI is InChI=1S/C19H20O3/c20-17(10-7-16-8-13-19(22)14-9-16)4-2-1-3-15-5-11-18(21)12-6-15/h2,4-6,8-9,11-14,21-22H,1,3,7,10H2/b4-2+.
What are the key properties of (E)-1,7-bis(4-hydroxyphenyl)hept-4-en-3-one?
(E)-1,7-bis(4-hydroxyphenyl)hept-4-en-3-one has a molecular weight of 296.37 g/mol, XLogP of 3.79, 7 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-1,7-bis(4-hydroxyphenyl)hept-4-en-3-one is sourced from PubChem (CID 23786382), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).