About 2-[(5-ethylsulfonyl-1,3-benzoxazol-2-yl)sulfanyl]-N-[2-(4-methoxyphenyl)ethyl]acetamide
2-[(5-ethylsulfonyl-1,3-benzoxazol-2-yl)sulfanyl]-N-[2-(4-methoxyphenyl)ethyl]acetamide (PubChem CID 2378674) has the molecular formula C20H22N2O5S2
and a molecular weight of 434.54 g/mol. Its IUPAC name is 2-[(5-ethylsulfonyl-1,3-benzoxazol-2-yl)sulfanyl]-N-[2-(4-methoxyphenyl)ethyl]acetamide.
Molecular Properties
| Compound Name | 2-[(5-ethylsulfonyl-1,3-benzoxazol-2-yl)sulfanyl]-N-[2-(4-methoxyphenyl)ethyl]acetamide |
| PubChem CID | 2378674 |
| Molecular Formula | C20H22N2O5S2 |
| Molecular Weight | 434.54 g/mol |
| Exact Mass | 434.10 |
| IUPAC Name | 2-[(5-ethylsulfonyl-1,3-benzoxazol-2-yl)sulfanyl]-N-[2-(4-methoxyphenyl)ethyl]acetamide |
| SMILES | CCS(=O)(=O)c1ccc2oc(SCC(=O)NCCc3ccc(OC)cc3)nc2c1 |
| InChI | InChI=1S/C20H22N2O5S2/c1-3-29(24,25)16-8-9-18-17(12-16)22-20(27-18)28-13-19(23)21-11-10-14-4-6-15(26-2)7-5-14/h4-9,12H,3,10-11,13H2,1-2H3,(H,21,23) |
| InChIKey | SOYLAGSYFJMXDT-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 98.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 434.54 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 2-[(5-ethylsulfonyl-1,3-benzoxazol-2-yl)sulfanyl]-N-[2-(4-methoxyphenyl)ethyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(5-ethylsulfonyl-1,3-benzoxazol-2-yl)sulfanyl]-N-[2-(4-methoxyphenyl)ethyl]acetamide?
The IUPAC name of 2-[(5-ethylsulfonyl-1,3-benzoxazol-2-yl)sulfanyl]-N-[2-(4-methoxyphenyl)ethyl]acetamide (CID 2378674) is 2-[(5-ethylsulfonyl-1,3-benzoxazol-2-yl)sulfanyl]-N-[2-(4-methoxyphenyl)ethyl]acetamide.
What is the SMILES notation for 2-[(5-ethylsulfonyl-1,3-benzoxazol-2-yl)sulfanyl]-N-[2-(4-methoxyphenyl)ethyl]acetamide?
The canonical SMILES for 2-[(5-ethylsulfonyl-1,3-benzoxazol-2-yl)sulfanyl]-N-[2-(4-methoxyphenyl)ethyl]acetamide is CCS(=O)(=O)c1ccc2oc(SCC(=O)NCCc3ccc(OC)cc3)nc2c1.
What is the InChIKey of 2-[(5-ethylsulfonyl-1,3-benzoxazol-2-yl)sulfanyl]-N-[2-(4-methoxyphenyl)ethyl]acetamide?
The InChIKey is SOYLAGSYFJMXDT-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H22N2O5S2/c1-3-29(24,25)16-8-9-18-17(12-16)22-20(27-18)28-13-19(23)21-11-10-14-4-6-15(26-2)7-5-14/h4-9,12H,3,10-11,13H2,1-2H3,(H,21,23).
What are the key properties of 2-[(5-ethylsulfonyl-1,3-benzoxazol-2-yl)sulfanyl]-N-[2-(4-methoxyphenyl)ethyl]acetamide?
2-[(5-ethylsulfonyl-1,3-benzoxazol-2-yl)sulfanyl]-N-[2-(4-methoxyphenyl)ethyl]acetamide has a molecular weight of 434.54 g/mol, XLogP of 3.08, 9 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(5-ethylsulfonyl-1,3-benzoxazol-2-yl)sulfanyl]-N-[2-(4-methoxyphenyl)ethyl]acetamide is sourced from PubChem (CID 2378674), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).