C26H37N3O6Si — CID 23786885
(3R,3'R,4'S,5'R)-4'-[hydroxy(dimethyl)silyl]-5'-[2-[(2S)-2-(hydroxymethyl)pyrrolidin-1-yl]-2-oxoethyl]-1,3'-dimethyl-5-(2-oxopyrrolidin-1-yl)spiro[indole-3,2'-oxolane]-2-one (PubChem CID 23786885) has the molecular formula C26H37N3O6Si and a molecular weight of 515.68 g/mol. Its IUPAC name is (3R,3'R,4'S,5'R)-4'-[hydroxy(dimethyl)silyl]-5'-[2-[(2S)-2-(hydroxymethyl)pyrrolidin-1-yl]-2-oxoethyl]-1,3'-dimethyl-5-(2-oxopyrrolidin-1-yl)spiro[indole-3,2'-oxolane]-2-one.
| Compound Name | (3R,3'R,4'S,5'R)-4'-[hydroxy(dimethyl)silyl]-5'-[2-[(2S)-2-(hydroxymethyl)pyrrolidin-1-yl]-2-oxoethyl]-1,3'-dimethyl-5-(2-oxopyrrolidin-1-yl)spiro[indole-3,2'-oxolane]-2-one |
|---|---|
| PubChem CID | 23786885 |
| Molecular Formula | C26H37N3O6Si |
| Molecular Weight | 515.68 g/mol |
| Exact Mass | 515.25 |
| IUPAC Name | (3R,3'R,4'S,5'R)-4'-[hydroxy(dimethyl)silyl]-5'-[2-[(2S)-2-(hydroxymethyl)pyrrolidin-1-yl]-2-oxoethyl]-1,3'-dimethyl-5-(2-oxopyrrolidin-1-yl)spiro[indole-3,2'-oxolane]-2-one |
| SMILES | C[C@H]1[C@H]([Si](C)(C)O)[C@@H](CC(=O)N2CCC[C@H]2CO)O[C@]12C(=O)N(C)c1ccc(N3CCCC3=O)cc12 |
| InChI | InChI=1S/C26H37N3O6Si/c1-16-24(36(3,4)34)21(14-23(32)29-11-5-7-18(29)15-30)35-26(16)19-13-17(28-12-6-8-22(28)31)9-10-20(19)27(2)25(26)33/h9-10,13,16,18,21,24,30,34H,5-8,11-12,14-15H2,1-4H3/t16-,18-,21+,24-,26+/m0/s1 |
| InChIKey | OBYWDVRINIEPPV-GZIWFXCPSA-N |
| XLogP | 1.96 |
| TPSA | 110.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.68 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|