C39H41ClN4O4Si — CID 23787089
(3S,3'S,4'R,5'S)-5-chloro-5'-[2-[4-(2-hydroxy-1-phenylethyl)triazol-1-yl]ethyl]-4'-[(4-methoxyphenyl)-dimethylsilyl]-3'-methyl-1-phenylspiro[indole-3,2'-oxolane]-2-one (PubChem CID 23787089) has the molecular formula C39H41ClN4O4Si and a molecular weight of 693.32 g/mol. Its IUPAC name is (3S,3'S,4'R,5'S)-5-chloro-5'-[2-[4-(2-hydroxy-1-phenylethyl)triazol-1-yl]ethyl]-4'-[(4-methoxyphenyl)-dimethylsilyl]-3'-methyl-1-phenylspiro[indole-3,2'-oxolane]-2-one.
| Compound Name | (3S,3'S,4'R,5'S)-5-chloro-5'-[2-[4-(2-hydroxy-1-phenylethyl)triazol-1-yl]ethyl]-4'-[(4-methoxyphenyl)-dimethylsilyl]-3'-methyl-1-phenylspiro[indole-3,2'-oxolane]-2-one |
|---|---|
| PubChem CID | 23787089 |
| Molecular Formula | C39H41ClN4O4Si |
| Molecular Weight | 693.32 g/mol |
| Exact Mass | 692.26 |
| IUPAC Name | (3S,3'S,4'R,5'S)-5-chloro-5'-[2-[4-(2-hydroxy-1-phenylethyl)triazol-1-yl]ethyl]-4'-[(4-methoxyphenyl)-dimethylsilyl]-3'-methyl-1-phenylspiro[indole-3,2'-oxolane]-2-one |
| SMILES | COc1ccc([Si](C)(C)[C@H]2[C@H](CCn3cc(C(CO)c4ccccc4)nn3)O[C@@]3(C(=O)N(c4ccccc4)c4ccc(Cl)cc43)[C@@H]2C)cc1 |
| InChI | InChI=1S/C39H41ClN4O4Si/c1-26-37(49(3,4)31-18-16-30(47-2)17-19-31)36(21-22-43-24-34(41-42-43)32(25-45)27-11-7-5-8-12-27)48-39(26)33-23-28(40)15-20-35(33)44(38(39)46)29-13-9-6-10-14-29/h5-20,23-24,26,32,36-37,45H,21-22,25H2,1-4H3/t26-,32?,36+,37-,39+/m1/s1 |
| InChIKey | XONCHMXMJBDOLU-FYPBDQNSSA-N |
| XLogP | 7.05 |
| TPSA | 89.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 693.32 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|