C37H46N10O3 — CID 23787182
4-N-(3,3-diphenylpropyl)-2-N-(2-methylcyclohexyl)-6-N-[6-[(4-nitro-2,1,3-benzoxadiazol-7-yl)amino]hexyl]-1,3,5-triazine-2,4,6-triamine (PubChem CID 23787182) has the molecular formula C37H46N10O3 and a molecular weight of 678.84 g/mol. Its IUPAC name is 4-N-(3,3-diphenylpropyl)-2-N-(2-methylcyclohexyl)-6-N-[6-[(4-nitro-2,1,3-benzoxadiazol-7-yl)amino]hexyl]-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 4-N-(3,3-diphenylpropyl)-2-N-(2-methylcyclohexyl)-6-N-[6-[(4-nitro-2,1,3-benzoxadiazol-7-yl)amino]hexyl]-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 23787182 |
| Molecular Formula | C37H46N10O3 |
| Molecular Weight | 678.84 g/mol |
| Exact Mass | 678.38 |
| IUPAC Name | 4-N-(3,3-diphenylpropyl)-2-N-(2-methylcyclohexyl)-6-N-[6-[(4-nitro-2,1,3-benzoxadiazol-7-yl)amino]hexyl]-1,3,5-triazine-2,4,6-triamine |
| SMILES | CC1CCCCC1Nc1nc(NCCCCCCNc2ccc([N+](=O)[O-])c3nonc23)nc(NCCC(c2ccccc2)c2ccccc2)n1 |
| InChI | InChI=1S/C37H46N10O3/c1-26-14-10-11-19-30(26)41-37-43-35(39-24-13-3-2-12-23-38-31-20-21-32(47(48)49)34-33(31)45-50-46-34)42-36(44-37)40-25-22-29(27-15-6-4-7-16-27)28-17-8-5-9-18-28/h4-9,15-18,20-21,26,29-30,38H,2-3,10-14,19,22-25H2,1H3,(H3,39,40,41,42,43,44) |
| InChIKey | CHLJMTQYSMJJGE-UHFFFAOYSA-N |
| XLogP | 8.03 |
| TPSA | 168.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 50 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.84 |
| LogP ≤ 5 | 8.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|