C25H34FN7O4 — CID 23787584
6-N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]-2-N-[(2,3-dimethoxyphenyl)methyl]-4-N-[(4-fluorophenyl)methyl]-1,3,5-triazine-2,4,6-triamine (PubChem CID 23787584) has the molecular formula C25H34FN7O4 and a molecular weight of 515.59 g/mol. Its IUPAC name is 6-N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]-2-N-[(2,3-dimethoxyphenyl)methyl]-4-N-[(4-fluorophenyl)methyl]-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 6-N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]-2-N-[(2,3-dimethoxyphenyl)methyl]-4-N-[(4-fluorophenyl)methyl]-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 23787584 |
| Molecular Formula | C25H34FN7O4 |
| Molecular Weight | 515.59 g/mol |
| Exact Mass | 515.27 |
| IUPAC Name | 6-N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]-2-N-[(2,3-dimethoxyphenyl)methyl]-4-N-[(4-fluorophenyl)methyl]-1,3,5-triazine-2,4,6-triamine |
| SMILES | COc1cccc(CNc2nc(NCCOCCOCCN)nc(NCc3ccc(F)cc3)n2)c1OC |
| InChI | InChI=1S/C25H34FN7O4/c1-34-21-5-3-4-19(22(21)35-2)17-30-25-32-23(28-11-13-37-15-14-36-12-10-27)31-24(33-25)29-16-18-6-8-20(26)9-7-18/h3-9H,10-17,27H2,1-2H3,(H3,28,29,30,31,32,33) |
| InChIKey | AOCJELBYBOOTJL-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 137.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.59 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|