C27H31N3O2 — CID 23787787
N'-ethyl-N'-[6-imino-9-(3-methoxyphenyl)xanthen-3-yl]-N,N-dimethylpropane-1,3-diamine (PubChem CID 23787787) has the molecular formula C27H31N3O2 and a molecular weight of 429.56 g/mol. Its IUPAC name is N'-ethyl-N'-[6-imino-9-(3-methoxyphenyl)xanthen-3-yl]-N,N-dimethylpropane-1,3-diamine.
| Compound Name | N'-ethyl-N'-[6-imino-9-(3-methoxyphenyl)xanthen-3-yl]-N,N-dimethylpropane-1,3-diamine |
|---|---|
| PubChem CID | 23787787 |
| Molecular Formula | C27H31N3O2 |
| Molecular Weight | 429.56 g/mol |
| Exact Mass | 429.24 |
| IUPAC Name | N'-ethyl-N'-[6-imino-9-(3-methoxyphenyl)xanthen-3-yl]-N,N-dimethylpropane-1,3-diamine |
| SMILES | [H]/N=c1\ccc2c(-c3cccc(OC)c3)c3ccc(N(CC)CCCN(C)C)cc3oc-2c1 |
| InChI | InChI=1S/C27H31N3O2/c1-5-30(15-7-14-29(2)3)21-11-13-24-26(18-21)32-25-17-20(28)10-12-23(25)27(24)19-8-6-9-22(16-19)31-4/h6,8-13,16-18,28H,5,7,14-15H2,1-4H3/b28-20+ |
| InChIKey | PVDPATJASQQOPY-VFCFBJKWSA-N |
| XLogP | 5.47 |
| TPSA | 52.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.56 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|