C22H30FNO5Si — CID 23788462
1-[(2R,3R,4R)-2-[1-[fluoro(dimethyl)silyl]-3-hydroxypropyl]-4-methoxy-3-methyl-3,4-dihydro-2H-chromen-6-yl]-3-methoxypyridin-2-one (PubChem CID 23788462) has the molecular formula C22H30FNO5Si and a molecular weight of 435.57 g/mol. Its IUPAC name is 1-[(2R,3R,4R)-2-[1-[fluoro(dimethyl)silyl]-3-hydroxypropyl]-4-methoxy-3-methyl-3,4-dihydro-2H-chromen-6-yl]-3-methoxypyridin-2-one.
| Compound Name | 1-[(2R,3R,4R)-2-[1-[fluoro(dimethyl)silyl]-3-hydroxypropyl]-4-methoxy-3-methyl-3,4-dihydro-2H-chromen-6-yl]-3-methoxypyridin-2-one |
|---|---|
| PubChem CID | 23788462 |
| Molecular Formula | C22H30FNO5Si |
| Molecular Weight | 435.57 g/mol |
| Exact Mass | 435.19 |
| IUPAC Name | 1-[(2R,3R,4R)-2-[1-[fluoro(dimethyl)silyl]-3-hydroxypropyl]-4-methoxy-3-methyl-3,4-dihydro-2H-chromen-6-yl]-3-methoxypyridin-2-one |
| SMILES | COc1cccn(-c2ccc3c(c2)[C@H](OC)[C@@H](C)[C@H](C(CCO)[Si](C)(C)F)O3)c1=O |
| InChI | InChI=1S/C22H30FNO5Si/c1-14-20(28-3)16-13-15(24-11-6-7-18(27-2)22(24)26)8-9-17(16)29-21(14)19(10-12-25)30(4,5)23/h6-9,11,13-14,19-21,25H,10,12H2,1-5H3/t14-,19?,20-,21-/m1/s1 |
| InChIKey | PSSHIYCTOXNBJV-FEHUSIJLSA-N |
| XLogP | 3.86 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.57 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|