C31H38N2O4Si — CID 23788523
2-[3-[2-[(2S,3R,4S,5R)-5-(2-hydroxyethyl)-4-[(4-methoxyphenyl)-dimethylsilyl]-3-methyloxolan-2-yl]ethyl]phenyl]-1H-indazol-3-one (PubChem CID 23788523) has the molecular formula C31H38N2O4Si and a molecular weight of 530.74 g/mol. Its IUPAC name is 2-[3-[2-[(2S,3R,4S,5R)-5-(2-hydroxyethyl)-4-[(4-methoxyphenyl)-dimethylsilyl]-3-methyloxolan-2-yl]ethyl]phenyl]-1H-indazol-3-one.
| Compound Name | 2-[3-[2-[(2S,3R,4S,5R)-5-(2-hydroxyethyl)-4-[(4-methoxyphenyl)-dimethylsilyl]-3-methyloxolan-2-yl]ethyl]phenyl]-1H-indazol-3-one |
|---|---|
| PubChem CID | 23788523 |
| Molecular Formula | C31H38N2O4Si |
| Molecular Weight | 530.74 g/mol |
| Exact Mass | 530.26 |
| IUPAC Name | 2-[3-[2-[(2S,3R,4S,5R)-5-(2-hydroxyethyl)-4-[(4-methoxyphenyl)-dimethylsilyl]-3-methyloxolan-2-yl]ethyl]phenyl]-1H-indazol-3-one |
| SMILES | COc1ccc([Si](C)(C)[C@H]2[C@H](C)[C@H](CCc3cccc(-n4[nH]c5ccccc5c4=O)c3)O[C@@H]2CCO)cc1 |
| InChI | InChI=1S/C31H38N2O4Si/c1-21-28(37-29(18-19-34)30(21)38(3,4)25-15-13-24(36-2)14-16-25)17-12-22-8-7-9-23(20-22)33-31(35)26-10-5-6-11-27(26)32-33/h5-11,13-16,20-21,28-30,32,34H,12,17-19H2,1-4H3/t21-,28+,29-,30+/m1/s1 |
| InChIKey | CSLZFAKWQMQZBD-YUJRYHFISA-N |
| XLogP | 5.03 |
| TPSA | 76.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.74 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het_65_B(7)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|