C25H33NO4 — CID 23789611
(2R,3S,4S)-N-cyclohexyl-2-ethoxy-4-(4-ethynylphenyl)-3-(3-hydroxypropyl)-3,4-dihydro-2H-pyran-6-carboxamide (PubChem CID 23789611) has the molecular formula C25H33NO4 and a molecular weight of 411.54 g/mol. Its IUPAC name is (2R,3S,4S)-N-cyclohexyl-2-ethoxy-4-(4-ethynylphenyl)-3-(3-hydroxypropyl)-3,4-dihydro-2H-pyran-6-carboxamide.
| Compound Name | (2R,3S,4S)-N-cyclohexyl-2-ethoxy-4-(4-ethynylphenyl)-3-(3-hydroxypropyl)-3,4-dihydro-2H-pyran-6-carboxamide |
|---|---|
| PubChem CID | 23789611 |
| Molecular Formula | C25H33NO4 |
| Molecular Weight | 411.54 g/mol |
| Exact Mass | 411.24 |
| IUPAC Name | (2R,3S,4S)-N-cyclohexyl-2-ethoxy-4-(4-ethynylphenyl)-3-(3-hydroxypropyl)-3,4-dihydro-2H-pyran-6-carboxamide |
| SMILES | C#Cc1ccc([C@H]2C=C(C(=O)NC3CCCCC3)O[C@@H](OCC)[C@H]2CCCO)cc1 |
| InChI | InChI=1S/C25H33NO4/c1-3-18-12-14-19(15-13-18)22-17-23(24(28)26-20-9-6-5-7-10-20)30-25(29-4-2)21(22)11-8-16-27/h1,12-15,17,20-22,25,27H,4-11,16H2,2H3,(H,26,28)/t21-,22+,25+/m0/s1 |
| InChIKey | MADRPKHBPHIKPJ-SGIRGMQISA-N |
| XLogP | 3.87 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.54 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|