C18H23NO4S — CID 23789696
(2S,3R,4R)-2-ethoxy-3-(3-hydroxypropyl)-N-prop-2-ynyl-4-thiophen-3-yl-3,4-dihydro-2H-pyran-6-carboxamide (PubChem CID 23789696) has the molecular formula C18H23NO4S and a molecular weight of 349.45 g/mol. Its IUPAC name is (2S,3R,4R)-2-ethoxy-3-(3-hydroxypropyl)-N-prop-2-ynyl-4-thiophen-3-yl-3,4-dihydro-2H-pyran-6-carboxamide.
| Compound Name | (2S,3R,4R)-2-ethoxy-3-(3-hydroxypropyl)-N-prop-2-ynyl-4-thiophen-3-yl-3,4-dihydro-2H-pyran-6-carboxamide |
|---|---|
| PubChem CID | 23789696 |
| Molecular Formula | C18H23NO4S |
| Molecular Weight | 349.45 g/mol |
| Exact Mass | 349.13 |
| IUPAC Name | (2S,3R,4R)-2-ethoxy-3-(3-hydroxypropyl)-N-prop-2-ynyl-4-thiophen-3-yl-3,4-dihydro-2H-pyran-6-carboxamide |
| SMILES | C#CCNC(=O)C1=C[C@@H](c2ccsc2)[C@@H](CCCO)[C@@H](OCC)O1 |
| InChI | InChI=1S/C18H23NO4S/c1-3-8-19-17(21)16-11-15(13-7-10-24-12-13)14(6-5-9-20)18(23-16)22-4-2/h1,7,10-12,14-15,18,20H,4-6,8-9H2,2H3,(H,19,21)/t14-,15+,18+/m1/s1 |
| InChIKey | NPUCYHIFCNIUFM-VKJFTORMSA-N |
| XLogP | 2.25 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.45 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|