About 1-[2,4-bis(difluoromethoxy)phenyl]-N-piperidin-1-ylmethanimine
1-[2,4-bis(difluoromethoxy)phenyl]-N-piperidin-1-ylmethanimine (PubChem CID 2379009) has the molecular formula C14H16F4N2O2
and a molecular weight of 320.29 g/mol. Its IUPAC name is 1-[2,4-bis(difluoromethoxy)phenyl]-N-piperidin-1-ylmethanimine.
Molecular Properties
| Compound Name | 1-[2,4-bis(difluoromethoxy)phenyl]-N-piperidin-1-ylmethanimine |
| PubChem CID | 2379009 |
| Molecular Formula | C14H16F4N2O2 |
| Molecular Weight | 320.29 g/mol |
| Exact Mass | 320.11 |
| IUPAC Name | 1-[2,4-bis(difluoromethoxy)phenyl]-N-piperidin-1-ylmethanimine |
| SMILES | FC(F)Oc1ccc(C=NN2CCCCC2)c(OC(F)F)c1 |
| InChI | InChI=1S/C14H16F4N2O2/c15-13(16)21-11-5-4-10(12(8-11)22-14(17)18)9-19-20-6-2-1-3-7-20/h4-5,8-9,13-14H,1-3,6-7H2 |
| InChIKey | YQEYNIKVWYQALE-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 34.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.29 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 1-[2,4-bis(difluoromethoxy)phenyl]-N-piperidin-1-ylmethanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2,4-bis(difluoromethoxy)phenyl]-N-piperidin-1-ylmethanimine?
The IUPAC name of 1-[2,4-bis(difluoromethoxy)phenyl]-N-piperidin-1-ylmethanimine (CID 2379009) is 1-[2,4-bis(difluoromethoxy)phenyl]-N-piperidin-1-ylmethanimine.
What is the SMILES notation for 1-[2,4-bis(difluoromethoxy)phenyl]-N-piperidin-1-ylmethanimine?
The canonical SMILES for 1-[2,4-bis(difluoromethoxy)phenyl]-N-piperidin-1-ylmethanimine is FC(F)Oc1ccc(C=NN2CCCCC2)c(OC(F)F)c1.
What is the InChIKey of 1-[2,4-bis(difluoromethoxy)phenyl]-N-piperidin-1-ylmethanimine?
The InChIKey is YQEYNIKVWYQALE-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16F4N2O2/c15-13(16)21-11-5-4-10(12(8-11)22-14(17)18)9-19-20-6-2-1-3-7-20/h4-5,8-9,13-14H,1-3,6-7H2.
What are the key properties of 1-[2,4-bis(difluoromethoxy)phenyl]-N-piperidin-1-ylmethanimine?
1-[2,4-bis(difluoromethoxy)phenyl]-N-piperidin-1-ylmethanimine has a molecular weight of 320.29 g/mol, XLogP of 3.71, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2,4-bis(difluoromethoxy)phenyl]-N-piperidin-1-ylmethanimine is sourced from PubChem (CID 2379009), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).