C17H17ClN2O2 — CID 23790368
5'-chloro-1,1,2'-trimethylspiro[5,6-dihydro-[1,3]oxazolo[3,4-a]pyridine-7,3'-indole]-3-one (PubChem CID 23790368) has the molecular formula C17H17ClN2O2 and a molecular weight of 316.79 g/mol. Its IUPAC name is 5'-chloro-1,1,2'-trimethylspiro[5,6-dihydro-[1,3]oxazolo[3,4-a]pyridine-7,3'-indole]-3-one.
| Compound Name | 5'-chloro-1,1,2'-trimethylspiro[5,6-dihydro-[1,3]oxazolo[3,4-a]pyridine-7,3'-indole]-3-one |
|---|---|
| PubChem CID | 23790368 |
| Molecular Formula | C17H17ClN2O2 |
| Molecular Weight | 316.79 g/mol |
| Exact Mass | 316.10 |
| IUPAC Name | 5'-chloro-1,1,2'-trimethylspiro[5,6-dihydro-[1,3]oxazolo[3,4-a]pyridine-7,3'-indole]-3-one |
| SMILES | CC1=Nc2ccc(Cl)cc2C12C=C1N(CC2)C(=O)OC1(C)C |
| InChI | InChI=1S/C17H17ClN2O2/c1-10-17(12-8-11(18)4-5-13(12)19-10)6-7-20-14(9-17)16(2,3)22-15(20)21/h4-5,8-9H,6-7H2,1-3H3 |
| InChIKey | URVGKKJZRHTCKQ-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.79 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |