About 2-[benzyl-[(5,7-dimethylimidazo[1,2-a]pyrimidin-2-yl)methyl]amino]ethanol
2-[benzyl-[(5,7-dimethylimidazo[1,2-a]pyrimidin-2-yl)methyl]amino]ethanol (PubChem CID 23790947) has the molecular formula C18H22N4O
and a molecular weight of 310.40 g/mol. Its IUPAC name is 2-[benzyl-[(5,7-dimethylimidazo[1,2-a]pyrimidin-2-yl)methyl]amino]ethanol.
Molecular Properties
| Compound Name | 2-[benzyl-[(5,7-dimethylimidazo[1,2-a]pyrimidin-2-yl)methyl]amino]ethanol |
| PubChem CID | 23790947 |
| Molecular Formula | C18H22N4O |
| Molecular Weight | 310.40 g/mol |
| Exact Mass | 310.18 |
| IUPAC Name | 2-[benzyl-[(5,7-dimethylimidazo[1,2-a]pyrimidin-2-yl)methyl]amino]ethanol |
| SMILES | Cc1cc(C)n2cc(CN(CCO)Cc3ccccc3)nc2n1 |
| InChI | InChI=1S/C18H22N4O/c1-14-10-15(2)22-13-17(20-18(22)19-14)12-21(8-9-23)11-16-6-4-3-5-7-16/h3-7,10,13,23H,8-9,11-12H2,1-2H3 |
| InChIKey | LUYXDRQJMGHQPM-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 53.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.40 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[benzyl-[(5,7-dimethylimidazo[1,2-a]pyrimidin-2-yl)methyl]amino]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[benzyl-[(5,7-dimethylimidazo[1,2-a]pyrimidin-2-yl)methyl]amino]ethanol?
The IUPAC name of 2-[benzyl-[(5,7-dimethylimidazo[1,2-a]pyrimidin-2-yl)methyl]amino]ethanol (CID 23790947) is 2-[benzyl-[(5,7-dimethylimidazo[1,2-a]pyrimidin-2-yl)methyl]amino]ethanol.
What is the SMILES notation for 2-[benzyl-[(5,7-dimethylimidazo[1,2-a]pyrimidin-2-yl)methyl]amino]ethanol?
The canonical SMILES for 2-[benzyl-[(5,7-dimethylimidazo[1,2-a]pyrimidin-2-yl)methyl]amino]ethanol is Cc1cc(C)n2cc(CN(CCO)Cc3ccccc3)nc2n1.
What is the InChIKey of 2-[benzyl-[(5,7-dimethylimidazo[1,2-a]pyrimidin-2-yl)methyl]amino]ethanol?
The InChIKey is LUYXDRQJMGHQPM-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H22N4O/c1-14-10-15(2)22-13-17(20-18(22)19-14)12-21(8-9-23)11-16-6-4-3-5-7-16/h3-7,10,13,23H,8-9,11-12H2,1-2H3.
What are the key properties of 2-[benzyl-[(5,7-dimethylimidazo[1,2-a]pyrimidin-2-yl)methyl]amino]ethanol?
2-[benzyl-[(5,7-dimethylimidazo[1,2-a]pyrimidin-2-yl)methyl]amino]ethanol has a molecular weight of 310.40 g/mol, XLogP of 2.34, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[benzyl-[(5,7-dimethylimidazo[1,2-a]pyrimidin-2-yl)methyl]amino]ethanol is sourced from PubChem (CID 23790947), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).