About 3-[(3,4-dichlorophenyl)methyl]-1-[2-(diethylamino)ethyl]-2-iminoquinazolin-4-one
3-[(3,4-dichlorophenyl)methyl]-1-[2-(diethylamino)ethyl]-2-iminoquinazolin-4-one (PubChem CID 23791451) has the molecular formula C21H24Cl2N4O
and a molecular weight of 419.36 g/mol. Its IUPAC name is 3-[(3,4-dichlorophenyl)methyl]-1-[2-(diethylamino)ethyl]-2-iminoquinazolin-4-one.
Molecular Properties
| Compound Name | 3-[(3,4-dichlorophenyl)methyl]-1-[2-(diethylamino)ethyl]-2-iminoquinazolin-4-one |
| PubChem CID | 23791451 |
| Molecular Formula | C21H24Cl2N4O |
| Molecular Weight | 419.36 g/mol |
| Exact Mass | 418.13 |
| IUPAC Name | 3-[(3,4-dichlorophenyl)methyl]-1-[2-(diethylamino)ethyl]-2-iminoquinazolin-4-one |
| SMILES | [H]/N=c1\n(Cc2ccc(Cl)c(Cl)c2)c(=O)c2ccccc2n1CCN(CC)CC |
| InChI | InChI=1S/C21H24Cl2N4O/c1-3-25(4-2)11-12-26-19-8-6-5-7-16(19)20(28)27(21(26)24)14-15-9-10-17(22)18(23)13-15/h5-10,13,24H,3-4,11-12,14H2,1-2H3/b24-21- |
| InChIKey | YHLWBKZPHDSDFP-FLFQWRMESA-N |
| XLogP | 3.98 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 419.36 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-[(3,4-dichlorophenyl)methyl]-1-[2-(diethylamino)ethyl]-2-iminoquinazolin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(3,4-dichlorophenyl)methyl]-1-[2-(diethylamino)ethyl]-2-iminoquinazolin-4-one?
The IUPAC name of 3-[(3,4-dichlorophenyl)methyl]-1-[2-(diethylamino)ethyl]-2-iminoquinazolin-4-one (CID 23791451) is 3-[(3,4-dichlorophenyl)methyl]-1-[2-(diethylamino)ethyl]-2-iminoquinazolin-4-one.
What is the SMILES notation for 3-[(3,4-dichlorophenyl)methyl]-1-[2-(diethylamino)ethyl]-2-iminoquinazolin-4-one?
The canonical SMILES for 3-[(3,4-dichlorophenyl)methyl]-1-[2-(diethylamino)ethyl]-2-iminoquinazolin-4-one is [H]/N=c1\n(Cc2ccc(Cl)c(Cl)c2)c(=O)c2ccccc2n1CCN(CC)CC.
What is the InChIKey of 3-[(3,4-dichlorophenyl)methyl]-1-[2-(diethylamino)ethyl]-2-iminoquinazolin-4-one?
The InChIKey is YHLWBKZPHDSDFP-FLFQWRMESA-N. The full InChI is InChI=1S/C21H24Cl2N4O/c1-3-25(4-2)11-12-26-19-8-6-5-7-16(19)20(28)27(21(26)24)14-15-9-10-17(22)18(23)13-15/h5-10,13,24H,3-4,11-12,14H2,1-2H3/b24-21-.
What are the key properties of 3-[(3,4-dichlorophenyl)methyl]-1-[2-(diethylamino)ethyl]-2-iminoquinazolin-4-one?
3-[(3,4-dichlorophenyl)methyl]-1-[2-(diethylamino)ethyl]-2-iminoquinazolin-4-one has a molecular weight of 419.36 g/mol, XLogP of 3.98, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(3,4-dichlorophenyl)methyl]-1-[2-(diethylamino)ethyl]-2-iminoquinazolin-4-one is sourced from PubChem (CID 23791451), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).