About 3-(benzenesulfonyl)-2,5-dimethyl-5-phenyl-1,3-oxazolidine
3-(benzenesulfonyl)-2,5-dimethyl-5-phenyl-1,3-oxazolidine (PubChem CID 23791828) has the molecular formula C17H19NO3S
and a molecular weight of 317.41 g/mol. Its IUPAC name is 3-(benzenesulfonyl)-2,5-dimethyl-5-phenyl-1,3-oxazolidine.
Molecular Properties
| Compound Name | 3-(benzenesulfonyl)-2,5-dimethyl-5-phenyl-1,3-oxazolidine |
| PubChem CID | 23791828 |
| Molecular Formula | C17H19NO3S |
| Molecular Weight | 317.41 g/mol |
| Exact Mass | 317.11 |
| IUPAC Name | 3-(benzenesulfonyl)-2,5-dimethyl-5-phenyl-1,3-oxazolidine |
| SMILES | CC1OC(C)(c2ccccc2)CN1S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C17H19NO3S/c1-14-18(22(19,20)16-11-7-4-8-12-16)13-17(2,21-14)15-9-5-3-6-10-15/h3-12,14H,13H2,1-2H3 |
| InChIKey | KFEWMFFHERHEIV-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.41 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(benzenesulfonyl)-2,5-dimethyl-5-phenyl-1,3-oxazolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(benzenesulfonyl)-2,5-dimethyl-5-phenyl-1,3-oxazolidine?
The IUPAC name of 3-(benzenesulfonyl)-2,5-dimethyl-5-phenyl-1,3-oxazolidine (CID 23791828) is 3-(benzenesulfonyl)-2,5-dimethyl-5-phenyl-1,3-oxazolidine.
What is the SMILES notation for 3-(benzenesulfonyl)-2,5-dimethyl-5-phenyl-1,3-oxazolidine?
The canonical SMILES for 3-(benzenesulfonyl)-2,5-dimethyl-5-phenyl-1,3-oxazolidine is CC1OC(C)(c2ccccc2)CN1S(=O)(=O)c1ccccc1.
What is the InChIKey of 3-(benzenesulfonyl)-2,5-dimethyl-5-phenyl-1,3-oxazolidine?
The InChIKey is KFEWMFFHERHEIV-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H19NO3S/c1-14-18(22(19,20)16-11-7-4-8-12-16)13-17(2,21-14)15-9-5-3-6-10-15/h3-12,14H,13H2,1-2H3.
What are the key properties of 3-(benzenesulfonyl)-2,5-dimethyl-5-phenyl-1,3-oxazolidine?
3-(benzenesulfonyl)-2,5-dimethyl-5-phenyl-1,3-oxazolidine has a molecular weight of 317.41 g/mol, XLogP of 2.97, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(benzenesulfonyl)-2,5-dimethyl-5-phenyl-1,3-oxazolidine is sourced from PubChem (CID 23791828), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).