C16H19N3O2 — CID 2379236
2-(4-cyanophenoxy)-N'-[(3S)-3-methylcyclohexen-1-yl]acetohydrazide (PubChem CID 2379236) has the molecular formula C16H19N3O2 and a molecular weight of 285.35 g/mol. Its IUPAC name is 2-(4-cyanophenoxy)-N'-[(3S)-3-methylcyclohexen-1-yl]acetohydrazide.
| Compound Name | 2-(4-cyanophenoxy)-N'-[(3S)-3-methylcyclohexen-1-yl]acetohydrazide |
|---|---|
| PubChem CID | 2379236 |
| Molecular Formula | C16H19N3O2 |
| Molecular Weight | 285.35 g/mol |
| Exact Mass | 285.15 |
| IUPAC Name | 2-(4-cyanophenoxy)-N'-[(3S)-3-methylcyclohexen-1-yl]acetohydrazide |
| SMILES | C[C@@H]1C=C(NNC(=O)COc2ccc(C#N)cc2)CCC1 |
| InChI | InChI=1S/C16H19N3O2/c1-12-3-2-4-14(9-12)18-19-16(20)11-21-15-7-5-13(10-17)6-8-15/h5-9,12,18H,2-4,11H2,1H3,(H,19,20)/t12-/m0/s1 |
| InChIKey | QDTJZWHDRHLPAF-LBPRGKRZSA-N |
| XLogP | 2.26 |
| TPSA | 74.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.35 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|