C21H19Cl2N3OS — CID 23792672
1-(2,4-dichlorophenyl)-N-(2-methoxyphenyl)-3,4-dihydro-1H-pyrrolo[1,2-a]pyrazine-2-carbothioamide (PubChem CID 23792672) has the molecular formula C21H19Cl2N3OS and a molecular weight of 432.38 g/mol. Its IUPAC name is 1-(2,4-dichlorophenyl)-N-(2-methoxyphenyl)-3,4-dihydro-1H-pyrrolo[1,2-a]pyrazine-2-carbothioamide.
| Compound Name | 1-(2,4-dichlorophenyl)-N-(2-methoxyphenyl)-3,4-dihydro-1H-pyrrolo[1,2-a]pyrazine-2-carbothioamide |
|---|---|
| PubChem CID | 23792672 |
| Molecular Formula | C21H19Cl2N3OS |
| Molecular Weight | 432.38 g/mol |
| Exact Mass | 431.06 |
| IUPAC Name | 1-(2,4-dichlorophenyl)-N-(2-methoxyphenyl)-3,4-dihydro-1H-pyrrolo[1,2-a]pyrazine-2-carbothioamide |
| SMILES | COc1ccccc1NC(=S)N1CCn2cccc2C1c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C21H19Cl2N3OS/c1-27-19-7-3-2-5-17(19)24-21(28)26-12-11-25-10-4-6-18(25)20(26)15-9-8-14(22)13-16(15)23/h2-10,13,20H,11-12H2,1H3,(H,24,28) |
| InChIKey | HAOOFLRLVIXBJX-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 29.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.38 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|