About 5-methyl-N-(1,3-thiazol-2-yl)pyrazine-2-carboxamide
5-methyl-N-(1,3-thiazol-2-yl)pyrazine-2-carboxamide (PubChem CID 2379361) has the molecular formula C9H8N4OS
and a molecular weight of 220.26 g/mol. Its IUPAC name is 5-methyl-N-(1,3-thiazol-2-yl)pyrazine-2-carboxamide.
Molecular Properties
| Compound Name | 5-methyl-N-(1,3-thiazol-2-yl)pyrazine-2-carboxamide |
| PubChem CID | 2379361 |
| Molecular Formula | C9H8N4OS |
| Molecular Weight | 220.26 g/mol |
| Exact Mass | 220.04 |
| IUPAC Name | 5-methyl-N-(1,3-thiazol-2-yl)pyrazine-2-carboxamide |
| SMILES | Cc1cnc(C(=O)Nc2nccs2)cn1 |
| InChI | InChI=1S/C9H8N4OS/c1-6-4-12-7(5-11-6)8(14)13-9-10-2-3-15-9/h2-5H,1H3,(H,10,13,14) |
| InChIKey | FGEWVMQUDIVVTO-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 67.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.26 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-methyl-N-(1,3-thiazol-2-yl)pyrazine-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-N-(1,3-thiazol-2-yl)pyrazine-2-carboxamide?
The IUPAC name of 5-methyl-N-(1,3-thiazol-2-yl)pyrazine-2-carboxamide (CID 2379361) is 5-methyl-N-(1,3-thiazol-2-yl)pyrazine-2-carboxamide.
What is the SMILES notation for 5-methyl-N-(1,3-thiazol-2-yl)pyrazine-2-carboxamide?
The canonical SMILES for 5-methyl-N-(1,3-thiazol-2-yl)pyrazine-2-carboxamide is Cc1cnc(C(=O)Nc2nccs2)cn1.
What is the InChIKey of 5-methyl-N-(1,3-thiazol-2-yl)pyrazine-2-carboxamide?
The InChIKey is FGEWVMQUDIVVTO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8N4OS/c1-6-4-12-7(5-11-6)8(14)13-9-10-2-3-15-9/h2-5H,1H3,(H,10,13,14).
What are the key properties of 5-methyl-N-(1,3-thiazol-2-yl)pyrazine-2-carboxamide?
5-methyl-N-(1,3-thiazol-2-yl)pyrazine-2-carboxamide has a molecular weight of 220.26 g/mol, XLogP of 1.49, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-N-(1,3-thiazol-2-yl)pyrazine-2-carboxamide is sourced from PubChem (CID 2379361), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).