C30H24N4O4S — CID 23793759
N-benzyl-N-methyl-2-[(3-nitrophenyl)methylsulfanyl]-4-oxo-3-phenylquinazoline-7-carboxamide (PubChem CID 23793759) has the molecular formula C30H24N4O4S and a molecular weight of 536.61 g/mol. Its IUPAC name is N-benzyl-N-methyl-2-[(3-nitrophenyl)methylsulfanyl]-4-oxo-3-phenylquinazoline-7-carboxamide.
| Compound Name | N-benzyl-N-methyl-2-[(3-nitrophenyl)methylsulfanyl]-4-oxo-3-phenylquinazoline-7-carboxamide |
|---|---|
| PubChem CID | 23793759 |
| Molecular Formula | C30H24N4O4S |
| Molecular Weight | 536.61 g/mol |
| Exact Mass | 536.15 |
| IUPAC Name | N-benzyl-N-methyl-2-[(3-nitrophenyl)methylsulfanyl]-4-oxo-3-phenylquinazoline-7-carboxamide |
| SMILES | CN(Cc1ccccc1)C(=O)c1ccc2c(=O)n(-c3ccccc3)c(SCc3cccc([N+](=O)[O-])c3)nc2c1 |
| InChI | InChI=1S/C30H24N4O4S/c1-32(19-21-9-4-2-5-10-21)28(35)23-15-16-26-27(18-23)31-30(33(29(26)36)24-12-6-3-7-13-24)39-20-22-11-8-14-25(17-22)34(37)38/h2-18H,19-20H2,1H3 |
| InChIKey | WYELGXGMLONOHW-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 98.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.61 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|