About (4-cyanophenyl)methyl 2-methylsulfanylpyridine-3-carboxylate
(4-cyanophenyl)methyl 2-methylsulfanylpyridine-3-carboxylate (PubChem CID 2379490) has the molecular formula C15H12N2O2S
and a molecular weight of 284.34 g/mol. Its IUPAC name is (4-cyanophenyl)methyl 2-methylsulfanylpyridine-3-carboxylate.
Molecular Properties
| Compound Name | (4-cyanophenyl)methyl 2-methylsulfanylpyridine-3-carboxylate |
| PubChem CID | 2379490 |
| Molecular Formula | C15H12N2O2S |
| Molecular Weight | 284.34 g/mol |
| Exact Mass | 284.06 |
| IUPAC Name | (4-cyanophenyl)methyl 2-methylsulfanylpyridine-3-carboxylate |
| SMILES | CSc1ncccc1C(=O)OCc1ccc(C#N)cc1 |
| InChI | InChI=1S/C15H12N2O2S/c1-20-14-13(3-2-8-17-14)15(18)19-10-12-6-4-11(9-16)5-7-12/h2-8H,10H2,1H3 |
| InChIKey | WLHYLOCAUPRATP-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 62.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.34 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (4-cyanophenyl)methyl 2-methylsulfanylpyridine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-cyanophenyl)methyl 2-methylsulfanylpyridine-3-carboxylate?
The IUPAC name of (4-cyanophenyl)methyl 2-methylsulfanylpyridine-3-carboxylate (CID 2379490) is (4-cyanophenyl)methyl 2-methylsulfanylpyridine-3-carboxylate.
What is the SMILES notation for (4-cyanophenyl)methyl 2-methylsulfanylpyridine-3-carboxylate?
The canonical SMILES for (4-cyanophenyl)methyl 2-methylsulfanylpyridine-3-carboxylate is CSc1ncccc1C(=O)OCc1ccc(C#N)cc1.
What is the InChIKey of (4-cyanophenyl)methyl 2-methylsulfanylpyridine-3-carboxylate?
The InChIKey is WLHYLOCAUPRATP-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12N2O2S/c1-20-14-13(3-2-8-17-14)15(18)19-10-12-6-4-11(9-16)5-7-12/h2-8H,10H2,1H3.
What are the key properties of (4-cyanophenyl)methyl 2-methylsulfanylpyridine-3-carboxylate?
(4-cyanophenyl)methyl 2-methylsulfanylpyridine-3-carboxylate has a molecular weight of 284.34 g/mol, XLogP of 3.03, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (4-cyanophenyl)methyl 2-methylsulfanylpyridine-3-carboxylate is sourced from PubChem (CID 2379490), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).