C23H25N3O3S — CID 23796469
3-(3,4-dihydro-2H-naphthalen-1-ylideneamino)-N-methyl-4-(3,4,5-trimethoxyphenyl)-1,3-thiazol-2-imine (PubChem CID 23796469) has the molecular formula C23H25N3O3S and a molecular weight of 423.54 g/mol. Its IUPAC name is 3-(3,4-dihydro-2H-naphthalen-1-ylideneamino)-N-methyl-4-(3,4,5-trimethoxyphenyl)-1,3-thiazol-2-imine.
| Compound Name | 3-(3,4-dihydro-2H-naphthalen-1-ylideneamino)-N-methyl-4-(3,4,5-trimethoxyphenyl)-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 23796469 |
| Molecular Formula | C23H25N3O3S |
| Molecular Weight | 423.54 g/mol |
| Exact Mass | 423.16 |
| IUPAC Name | 3-(3,4-dihydro-2H-naphthalen-1-ylideneamino)-N-methyl-4-(3,4,5-trimethoxyphenyl)-1,3-thiazol-2-imine |
| SMILES | C/N=c1\scc(-c2cc(OC)c(OC)c(OC)c2)n1N=C1CCCc2ccccc21 |
| InChI | InChI=1S/C23H25N3O3S/c1-24-23-26(25-18-11-7-9-15-8-5-6-10-17(15)18)19(14-30-23)16-12-20(27-2)22(29-4)21(13-16)28-3/h5-6,8,10,12-14H,7,9,11H2,1-4H3/b24-23-,25-18? |
| InChIKey | DWPQPBNXLXUDIU-GZLSKJAYSA-N |
| XLogP | 4.36 |
| TPSA | 57.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.54 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|