About [2-(3,4-dimethoxyanilino)-2-oxoethyl] 2-(1H-indol-3-yl)acetate
[2-(3,4-dimethoxyanilino)-2-oxoethyl] 2-(1H-indol-3-yl)acetate (PubChem CID 2379658) has the molecular formula C20H20N2O5
and a molecular weight of 368.39 g/mol. Its IUPAC name is [2-(3,4-dimethoxyanilino)-2-oxoethyl] 2-(1H-indol-3-yl)acetate.
Molecular Properties
| Compound Name | [2-(3,4-dimethoxyanilino)-2-oxoethyl] 2-(1H-indol-3-yl)acetate |
| PubChem CID | 2379658 |
| Molecular Formula | C20H20N2O5 |
| Molecular Weight | 368.39 g/mol |
| Exact Mass | 368.14 |
| IUPAC Name | [2-(3,4-dimethoxyanilino)-2-oxoethyl] 2-(1H-indol-3-yl)acetate |
| SMILES | COc1ccc(NC(=O)COC(=O)Cc2c[nH]c3ccccc23)cc1OC |
| InChI | InChI=1S/C20H20N2O5/c1-25-17-8-7-14(10-18(17)26-2)22-19(23)12-27-20(24)9-13-11-21-16-6-4-3-5-15(13)16/h3-8,10-11,21H,9,12H2,1-2H3,(H,22,23) |
| InChIKey | BZRZDSKZRGQRMB-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 89.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 368.39 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [2-(3,4-dimethoxyanilino)-2-oxoethyl] 2-(1H-indol-3-yl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(3,4-dimethoxyanilino)-2-oxoethyl] 2-(1H-indol-3-yl)acetate?
The IUPAC name of [2-(3,4-dimethoxyanilino)-2-oxoethyl] 2-(1H-indol-3-yl)acetate (CID 2379658) is [2-(3,4-dimethoxyanilino)-2-oxoethyl] 2-(1H-indol-3-yl)acetate.
What is the SMILES notation for [2-(3,4-dimethoxyanilino)-2-oxoethyl] 2-(1H-indol-3-yl)acetate?
The canonical SMILES for [2-(3,4-dimethoxyanilino)-2-oxoethyl] 2-(1H-indol-3-yl)acetate is COc1ccc(NC(=O)COC(=O)Cc2c[nH]c3ccccc23)cc1OC.
What is the InChIKey of [2-(3,4-dimethoxyanilino)-2-oxoethyl] 2-(1H-indol-3-yl)acetate?
The InChIKey is BZRZDSKZRGQRMB-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H20N2O5/c1-25-17-8-7-14(10-18(17)26-2)22-19(23)12-27-20(24)9-13-11-21-16-6-4-3-5-15(13)16/h3-8,10-11,21H,9,12H2,1-2H3,(H,22,23).
What are the key properties of [2-(3,4-dimethoxyanilino)-2-oxoethyl] 2-(1H-indol-3-yl)acetate?
[2-(3,4-dimethoxyanilino)-2-oxoethyl] 2-(1H-indol-3-yl)acetate has a molecular weight of 368.39 g/mol, XLogP of 2.91, 7 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(3,4-dimethoxyanilino)-2-oxoethyl] 2-(1H-indol-3-yl)acetate is sourced from PubChem (CID 2379658), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).