C26H22N6O6S2 — CID 23798506
2-[3-[2-(4-methyl-2-nitroanilino)-2-oxoethyl]sulfanylquinoxalin-2-yl]sulfanyl-N-(4-methyl-2-nitrophenyl)acetamide (PubChem CID 23798506) has the molecular formula C26H22N6O6S2 and a molecular weight of 578.63 g/mol. Its IUPAC name is 2-[3-[2-(4-methyl-2-nitroanilino)-2-oxoethyl]sulfanylquinoxalin-2-yl]sulfanyl-N-(4-methyl-2-nitrophenyl)acetamide.
| Compound Name | 2-[3-[2-(4-methyl-2-nitroanilino)-2-oxoethyl]sulfanylquinoxalin-2-yl]sulfanyl-N-(4-methyl-2-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 23798506 |
| Molecular Formula | C26H22N6O6S2 |
| Molecular Weight | 578.63 g/mol |
| Exact Mass | 578.10 |
| IUPAC Name | 2-[3-[2-(4-methyl-2-nitroanilino)-2-oxoethyl]sulfanylquinoxalin-2-yl]sulfanyl-N-(4-methyl-2-nitrophenyl)acetamide |
| SMILES | Cc1ccc(NC(=O)CSc2nc3ccccc3nc2SCC(=O)Nc2ccc(C)cc2[N+](=O)[O-])c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C26H22N6O6S2/c1-15-7-9-19(21(11-15)31(35)36)27-23(33)13-39-25-26(30-18-6-4-3-5-17(18)29-25)40-14-24(34)28-20-10-8-16(2)12-22(20)32(37)38/h3-12H,13-14H2,1-2H3,(H,27,33)(H,28,34) |
| InChIKey | ZDLHFQIQFGHCDP-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 170.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.63 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|