C19H21FN4O4S — CID 23798658
N-(2-aminoethyl)-1-benzoyl-3-(4-fluorophenyl)sulfonylimidazolidine-2-carboxamide (PubChem CID 23798658) has the molecular formula C19H21FN4O4S and a molecular weight of 420.47 g/mol. Its IUPAC name is N-(2-aminoethyl)-1-benzoyl-3-(4-fluorophenyl)sulfonylimidazolidine-2-carboxamide.
| Compound Name | N-(2-aminoethyl)-1-benzoyl-3-(4-fluorophenyl)sulfonylimidazolidine-2-carboxamide |
|---|---|
| PubChem CID | 23798658 |
| Molecular Formula | C19H21FN4O4S |
| Molecular Weight | 420.47 g/mol |
| Exact Mass | 420.13 |
| IUPAC Name | N-(2-aminoethyl)-1-benzoyl-3-(4-fluorophenyl)sulfonylimidazolidine-2-carboxamide |
| SMILES | NCCNC(=O)C1N(C(=O)c2ccccc2)CCN1S(=O)(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C19H21FN4O4S/c20-15-6-8-16(9-7-15)29(27,28)24-13-12-23(18(24)17(25)22-11-10-21)19(26)14-4-2-1-3-5-14/h1-9,18H,10-13,21H2,(H,22,25) |
| InChIKey | UURGEBZDDOYRQL-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 112.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.47 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |