C22H24F2N4S — CID 2379886
2-[[cyclopropylmethyl(propyl)amino]methyl]-4-(2,4-difluorophenyl)-5-phenyl-1,2,4-triazole-3-thione (PubChem CID 2379886) has the molecular formula C22H24F2N4S and a molecular weight of 414.53 g/mol. Its IUPAC name is 2-[[cyclopropylmethyl(propyl)amino]methyl]-4-(2,4-difluorophenyl)-5-phenyl-1,2,4-triazole-3-thione.
| Compound Name | 2-[[cyclopropylmethyl(propyl)amino]methyl]-4-(2,4-difluorophenyl)-5-phenyl-1,2,4-triazole-3-thione |
|---|---|
| PubChem CID | 2379886 |
| Molecular Formula | C22H24F2N4S |
| Molecular Weight | 414.53 g/mol |
| Exact Mass | 414.17 |
| IUPAC Name | 2-[[cyclopropylmethyl(propyl)amino]methyl]-4-(2,4-difluorophenyl)-5-phenyl-1,2,4-triazole-3-thione |
| SMILES | CCCN(CC1CC1)Cn1nc(-c2ccccc2)n(-c2ccc(F)cc2F)c1=S |
| InChI | InChI=1S/C22H24F2N4S/c1-2-12-26(14-16-8-9-16)15-27-22(29)28(20-11-10-18(23)13-19(20)24)21(25-27)17-6-4-3-5-7-17/h3-7,10-11,13,16H,2,8-9,12,14-15H2,1H3 |
| InChIKey | XRZHEBPKIZEQGH-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 25.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.53 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|