C26H27FN4O2S — CID 2379950
2-[[2-(3,4-dimethoxyphenyl)ethyl-methylamino]methyl]-4-(4-fluorophenyl)-5-phenyl-1,2,4-triazole-3-thione (PubChem CID 2379950) has the molecular formula C26H27FN4O2S and a molecular weight of 478.59 g/mol. Its IUPAC name is 2-[[2-(3,4-dimethoxyphenyl)ethyl-methylamino]methyl]-4-(4-fluorophenyl)-5-phenyl-1,2,4-triazole-3-thione.
| Compound Name | 2-[[2-(3,4-dimethoxyphenyl)ethyl-methylamino]methyl]-4-(4-fluorophenyl)-5-phenyl-1,2,4-triazole-3-thione |
|---|---|
| PubChem CID | 2379950 |
| Molecular Formula | C26H27FN4O2S |
| Molecular Weight | 478.59 g/mol |
| Exact Mass | 478.18 |
| IUPAC Name | 2-[[2-(3,4-dimethoxyphenyl)ethyl-methylamino]methyl]-4-(4-fluorophenyl)-5-phenyl-1,2,4-triazole-3-thione |
| SMILES | COc1ccc(CCN(C)Cn2nc(-c3ccccc3)n(-c3ccc(F)cc3)c2=S)cc1OC |
| InChI | InChI=1S/C26H27FN4O2S/c1-29(16-15-19-9-14-23(32-2)24(17-19)33-3)18-30-26(34)31(22-12-10-21(27)11-13-22)25(28-30)20-7-5-4-6-8-20/h4-14,17H,15-16,18H2,1-3H3 |
| InChIKey | VAUUUNOQIQWWGD-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 44.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.59 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|