C32H29N3O4 — CID 23799513
1-benzyl-8,8-dimethyl-5-(3-phenoxyphenyl)-5,7,9,10-tetrahydropyrimido[4,5-b]quinoline-2,4,6-trione (PubChem CID 23799513) has the molecular formula C32H29N3O4 and a molecular weight of 519.60 g/mol. Its IUPAC name is 1-benzyl-8,8-dimethyl-5-(3-phenoxyphenyl)-5,7,9,10-tetrahydropyrimido[4,5-b]quinoline-2,4,6-trione.
| Compound Name | 1-benzyl-8,8-dimethyl-5-(3-phenoxyphenyl)-5,7,9,10-tetrahydropyrimido[4,5-b]quinoline-2,4,6-trione |
|---|---|
| PubChem CID | 23799513 |
| Molecular Formula | C32H29N3O4 |
| Molecular Weight | 519.60 g/mol |
| Exact Mass | 519.22 |
| IUPAC Name | 1-benzyl-8,8-dimethyl-5-(3-phenoxyphenyl)-5,7,9,10-tetrahydropyrimido[4,5-b]quinoline-2,4,6-trione |
| SMILES | CC1(C)CC(=O)C2=C(C1)Nc1c(c(=O)[nH]c(=O)n1Cc1ccccc1)C2c1cccc(Oc2ccccc2)c1 |
| InChI | InChI=1S/C32H29N3O4/c1-32(2)17-24-27(25(36)18-32)26(21-12-9-15-23(16-21)39-22-13-7-4-8-14-22)28-29(33-24)35(31(38)34-30(28)37)19-20-10-5-3-6-11-20/h3-16,26,33H,17-19H2,1-2H3,(H,34,37,38) |
| InChIKey | XWTQYPHWRGWSFF-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 93.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.60 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |