C30H26N6O4S — CID 23800076
6-[2-(2-nitrophenyl)imino-3-[2-(1,3,3-trimethylindol-2-ylidene)ethylideneamino]-1,3-thiazol-4-yl]-4H-1,4-benzoxazin-3-one (PubChem CID 23800076) has the molecular formula C30H26N6O4S and a molecular weight of 566.64 g/mol. Its IUPAC name is 6-[2-(2-nitrophenyl)imino-3-[2-(1,3,3-trimethylindol-2-ylidene)ethylideneamino]-1,3-thiazol-4-yl]-4H-1,4-benzoxazin-3-one.
| Compound Name | 6-[2-(2-nitrophenyl)imino-3-[2-(1,3,3-trimethylindol-2-ylidene)ethylideneamino]-1,3-thiazol-4-yl]-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 23800076 |
| Molecular Formula | C30H26N6O4S |
| Molecular Weight | 566.64 g/mol |
| Exact Mass | 566.17 |
| IUPAC Name | 6-[2-(2-nitrophenyl)imino-3-[2-(1,3,3-trimethylindol-2-ylidene)ethylideneamino]-1,3-thiazol-4-yl]-4H-1,4-benzoxazin-3-one |
| SMILES | CN1C(=CC=Nn2c(-c3ccc4c(c3)NC(=O)CO4)cs/c2=N\c2ccccc2[N+](=O)[O-])C(C)(C)c2ccccc21 |
| InChI | InChI=1S/C30H26N6O4S/c1-30(2)20-8-4-6-10-23(20)34(3)27(30)14-15-31-35-25(19-12-13-26-22(16-19)32-28(37)17-40-26)18-41-29(35)33-21-9-5-7-11-24(21)36(38)39/h4-16,18H,17H2,1-3H3,(H,32,37)/b27-14?,31-15?,33-29- |
| InChIKey | LVTVFRVNRHSRSI-NZCWIIDLSA-N |
| XLogP | 5.83 |
| TPSA | 114.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.64 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|