About 2-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonylamino)benzoic acid
2-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonylamino)benzoic acid (PubChem CID 2380119) has the molecular formula C15H13NO6S
and a molecular weight of 335.34 g/mol. Its IUPAC name is 2-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonylamino)benzoic acid.
Molecular Properties
| Compound Name | 2-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonylamino)benzoic acid |
| PubChem CID | 2380119 |
| Molecular Formula | C15H13NO6S |
| Molecular Weight | 335.34 g/mol |
| Exact Mass | 335.05 |
| IUPAC Name | 2-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonylamino)benzoic acid |
| SMILES | O=C(O)c1ccccc1NS(=O)(=O)c1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C15H13NO6S/c17-15(18)11-3-1-2-4-12(11)16-23(19,20)10-5-6-13-14(9-10)22-8-7-21-13/h1-6,9,16H,7-8H2,(H,17,18) |
| InChIKey | HRNCHBDCEHBSHD-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 335.34 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonylamino)benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonylamino)benzoic acid?
The IUPAC name of 2-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonylamino)benzoic acid (CID 2380119) is 2-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonylamino)benzoic acid.
What is the SMILES notation for 2-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonylamino)benzoic acid?
The canonical SMILES for 2-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonylamino)benzoic acid is O=C(O)c1ccccc1NS(=O)(=O)c1ccc2c(c1)OCCO2.
What is the InChIKey of 2-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonylamino)benzoic acid?
The InChIKey is HRNCHBDCEHBSHD-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13NO6S/c17-15(18)11-3-1-2-4-12(11)16-23(19,20)10-5-6-13-14(9-10)22-8-7-21-13/h1-6,9,16H,7-8H2,(H,17,18).
What are the key properties of 2-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonylamino)benzoic acid?
2-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonylamino)benzoic acid has a molecular weight of 335.34 g/mol, XLogP of 1.96, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonylamino)benzoic acid is sourced from PubChem (CID 2380119), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).