C19H23NOS — CID 23801401
2-benzylsulfanyl-N-(3,4-dimethylphenyl)butanamide (PubChem CID 23801401) has the molecular formula C19H23NOS and a molecular weight of 313.47 g/mol. Its IUPAC name is 2-benzylsulfanyl-N-(3,4-dimethylphenyl)butanamide.
| Compound Name | 2-benzylsulfanyl-N-(3,4-dimethylphenyl)butanamide |
|---|---|
| PubChem CID | 23801401 |
| Molecular Formula | C19H23NOS |
| Molecular Weight | 313.47 g/mol |
| Exact Mass | 313.15 |
| IUPAC Name | 2-benzylsulfanyl-N-(3,4-dimethylphenyl)butanamide |
| SMILES | CCC(SCc1ccccc1)C(=O)Nc1ccc(C)c(C)c1 |
| InChI | InChI=1S/C19H23NOS/c1-4-18(22-13-16-8-6-5-7-9-16)19(21)20-17-11-10-14(2)15(3)12-17/h5-12,18H,4,13H2,1-3H3,(H,20,21) |
| InChIKey | LZAIQNMGTGLLJG-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.47 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |