C15H14N2O6 — CID 2380164
[2-(2,6-Dimethylanilino)-2-oxoethyl] 5-nitrofuran-2-carboxylate (PubChem CID 2380164) has the molecular formula C15H14N2O6 and a molecular weight of 318.28 g/mol. Its IUPAC name is [2-(2,6-dimethylanilino)-2-oxoethyl] 5-nitrofuran-2-carboxylate.
| Compound Name | [2-(2,6-Dimethylanilino)-2-oxoethyl] 5-nitrofuran-2-carboxylate |
|---|---|
| PubChem CID | 2380164 |
| Molecular Formula | C15H14N2O6 |
| Molecular Weight | 318.28 g/mol |
| Exact Mass | 318.09 |
| IUPAC Name | [2-(2,6-dimethylanilino)-2-oxoethyl] 5-nitrofuran-2-carboxylate |
| SMILES | CC1=C(C(=CC=C1)C)NC(=O)COC(=O)C2=CC=C(O2)[N+](=O)[O-] |
| InChI | InChI=1S/C15H14N2O6/c1-9-4-3-5-10(2)14(9)16-12(18)8-22-15(19)11-6-7-13(23-11)17(20)21/h3-7H,8H2,1-2H3,(H,16,18) |
| InChIKey | KUCGIUUNNMUQSL-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 114.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | 453 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.28 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|