C24H24ClNOS — CID 23802
[2-(1-benzothiophen-3-yl)-2-hydroxyethyl]-dibenzylazanium chloride (PubChem CID 23802) has the molecular formula C24H24ClNOS and a molecular weight of 409.98 g/mol. Its IUPAC name is [2-(1-benzothiophen-3-yl)-2-hydroxyethyl]-dibenzylazanium chloride.
| Compound Name | [2-(1-benzothiophen-3-yl)-2-hydroxyethyl]-dibenzylazanium chloride |
|---|---|
| PubChem CID | 23802 |
| Molecular Formula | C24H24ClNOS |
| Molecular Weight | 409.98 g/mol |
| Exact Mass | 409.13 |
| IUPAC Name | [2-(1-benzothiophen-3-yl)-2-hydroxyethyl]-dibenzylazanium chloride |
| SMILES | OC(C[NH+](Cc1ccccc1)Cc1ccccc1)c1csc2ccccc12.[Cl-] |
| InChI | InChI=1S/C24H23NOS.ClH/c26-23(22-18-27-24-14-8-7-13-21(22)24)17-25(15-19-9-3-1-4-10-19)16-20-11-5-2-6-12-20;/h1-14,18,23,26H,15-17H2;1H |
| InChIKey | UMGKGASRVZWTRM-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 24.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.98 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |