C29H36N2O2 — CID 23802345
4-[4-(diethylamino)phenyl]-1-(3,5-dimethylphenyl)-7,7-dimethyl-3,4,6,8-tetrahydroquinoline-2,5-dione (PubChem CID 23802345) has the molecular formula C29H36N2O2 and a molecular weight of 444.62 g/mol. Its IUPAC name is 4-[4-(diethylamino)phenyl]-1-(3,5-dimethylphenyl)-7,7-dimethyl-3,4,6,8-tetrahydroquinoline-2,5-dione.
| Compound Name | 4-[4-(diethylamino)phenyl]-1-(3,5-dimethylphenyl)-7,7-dimethyl-3,4,6,8-tetrahydroquinoline-2,5-dione |
|---|---|
| PubChem CID | 23802345 |
| Molecular Formula | C29H36N2O2 |
| Molecular Weight | 444.62 g/mol |
| Exact Mass | 444.28 |
| IUPAC Name | 4-[4-(diethylamino)phenyl]-1-(3,5-dimethylphenyl)-7,7-dimethyl-3,4,6,8-tetrahydroquinoline-2,5-dione |
| SMILES | CCN(CC)c1ccc(C2CC(=O)N(c3cc(C)cc(C)c3)C3=C2C(=O)CC(C)(C)C3)cc1 |
| InChI | InChI=1S/C29H36N2O2/c1-7-30(8-2)22-11-9-21(10-12-22)24-16-27(33)31(23-14-19(3)13-20(4)15-23)25-17-29(5,6)18-26(32)28(24)25/h9-15,24H,7-8,16-18H2,1-6H3 |
| InChIKey | VRWSKUVBCGZLEN-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.62 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|